|
|
| | (+)-trans-4 5-Bis(iodomethyl)-2,2-dimethyl-1 3-dioxolane Basic information |
| Product Name: | (+)-trans-4 5-Bis(iodomethyl)-2,2-dimethyl-1 3-dioxolane | | Synonyms: | 4,5-Bis(iodomethyl)-2,2-dimethyl-1,3-dioxolane;1,3-Dioxolane, 4,5-bis(iodomethyl)-2,2-dimethyl-, (4R,5R)-;1,4-Dideoxy-1,4-diiodo-2,3-O-isopropylidene-L-threitol;(+)-trans-4 5-Bis(iodomethyl)-2,2-dimethyl-1 3-dioxolane | | CAS: | 58342-57-7 | | MF: | C7H12I2O2 | | MW: | 381.98 | | EINECS: | | | Product Categories: | | | Mol File: | 58342-57-7.mol |  |
| | (+)-trans-4 5-Bis(iodomethyl)-2,2-dimethyl-1 3-dioxolane Chemical Properties |
| Boiling point | 90 °C(Press: 0.1 Torr) | | density | 2.021±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | InChI | InChI=1S/C7H12I2O2/c1-7(2)10-5(3-8)6(4-9)11-7/h5-6H,3-4H2,1-2H3/t5-,6-/m0/s1 | | InChIKey | WHRBZHCFRKKRJE-WDSKDSINSA-N | | SMILES | O1[C@@H](CI)[C@H](CI)OC1(C)C |
| | (+)-trans-4 5-Bis(iodomethyl)-2,2-dimethyl-1 3-dioxolane Usage And Synthesis |
| | (+)-trans-4 5-Bis(iodomethyl)-2,2-dimethyl-1 3-dioxolane Preparation Products And Raw materials |
|