| Company Name: |
Inventichem
|
| Tel: |
+918790275459 |
| Email: |
sales@inventichem.co |
| Products Intro: |
Product Name:Cyclopenta[cd]pyrene
CAS:27208-37-3
Purity:98% Package:10 g, 25 g, 50 g, 100 g
|
|
| | CYCLOPENTA(C,D)PYRENE Basic information |
| | CYCLOPENTA(C,D)PYRENE Chemical Properties |
| Melting point | 175°C | | Boiling point | 302.89°C (rough estimate) | | density | 1.1624 (estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Amber Vial, -20°C Freezer, Under Inert Atmosphere | | solubility | Acetone (Slightly), Benzene (Slightly), Methanol (Slightly) | | form | Solid | | color | Orange to Dark Orange | | Stability: | Light Sensitive | | InChI | InChI=1S/C18H10/c1-2-11-4-6-13-7-5-12-8-9-15-10-14(3-1)16(11)18(13)17(12)15/h1-10H | | InChIKey | BZCXQYVNASLLQO-UHFFFAOYSA-N | | SMILES | C1C2C3=C4C(=CC=2)C=CC=C4C=C2C=CC(=C23)C=1 | | IARC | 2A (Vol. Sup 7, 92) 2010 | | EPA Substance Registry System | Cyclopenta[cd]pyrene (27208-37-3) |
| | CYCLOPENTA(C,D)PYRENE Usage And Synthesis |
| Uses | Acepyrene is a novel constituent discovered that belongs to the pyrene class of the polycyclic aromatic hydrocarbons. Acepyrene occurs in a large variety of carbon black soots, in cigarette smoke and
is the major representative of PAH in car engine exhaust gases. | | Definition | ChEBI: Cyclopenta[cd]pyrene is a member of pyrenes. |
| | CYCLOPENTA(C,D)PYRENE Preparation Products And Raw materials |
|