| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(R)-(+)-4-Methyl-4-(trichloroMethyl)-2-oxetanone CAS:93239-42-0 Purity:98% Package:5G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(R)-(+)-4-Methyl-4-(trichloromethyl)-2-oxetanone CAS:93239-42-0 Purity:98% Package:5G Remarks:340235-5G
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:(R)-(+)-4-Methyl-4-(trichloromethyl)-2-oxetanone CAS:93239-42-0
|
|
| | (R)-(+)-3-HYDROXY-3-METHYL-4,4,4-TRICHLOROBUTYRIC BETA-LACTONE Basic information |
| Product Name: | (R)-(+)-3-HYDROXY-3-METHYL-4,4,4-TRICHLOROBUTYRIC BETA-LACTONE | | Synonyms: | (R)-(+)-4-METHYL-4-(TRICHLOROMETHYL)-2-OXETANONE;R(+)-3-HYDROXY-3-METHYL-4,4,4-TRICHLOROBUTYRIC ACID BETA-LACTONE;(R)-(+)-3-HYDROXY-3-METHYL-4,4,4-TRICHLOROBUTYRIC BETA-LACTONE;(R)-(+)-3-hydroxy-3-methyl-4,4,4-trichlorobutyric;(r)-(+)-3-hydroxy-3-methyl-4,4,4-trichlorobutyric acid β-lactone;3-hydroxy-3-methyl-4,4,4-trichlorobutyric beta-lactone;(2R)-2β-(Trichloromethyl)-2-methyloxetane-4-one;(R)-4α-(Trichloromethyl)-4-methyloxetane-2-one | | CAS: | 93239-42-0 | | MF: | C5H5Cl3O2 | | MW: | 203.45 | | EINECS: | | | Product Categories: | | | Mol File: | 93239-42-0.mol |  |
| | (R)-(+)-3-HYDROXY-3-METHYL-4,4,4-TRICHLOROBUTYRIC BETA-LACTONE Chemical Properties |
| Melting point | 43-44 °C (lit.) | | Boiling point | 120 °C/0.1 mmHg (lit.) | | density | 1.6184 (rough estimate) | | refractive index | 1.4505 (estimate) | | Fp | >230 °F | | storage temp. | 2-8°C | | Optical Rotation | [α]26/D +6.0°, c = 2 in ethanol | | BRN | 5730854 | | InChI | 1S/C5H5Cl3O2/c1-4(5(6,7)8)2-3(9)10-4/h2H2,1H3/t4-/m1/s1 | | InChIKey | MIYJBPXTAZJPGX-SCSAIBSYSA-N | | SMILES | C[C@@]1(CC(=O)O1)C(Cl)(Cl)Cl |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 8-10-21 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (R)-(+)-3-HYDROXY-3-METHYL-4,4,4-TRICHLOROBUTYRIC BETA-LACTONE Usage And Synthesis |
| Uses | (4R)-4-Methyl-4-(trichloromethyl)-2-oxetanone can be used as LPA1 receptor antagonists to treat fibrosis. | | Uses | (R)-(+)-4-Methyl-4-(trichloromethyl)-2-oxetanone may be used in the preparation of (S)-citramalic acid. |
| | (R)-(+)-3-HYDROXY-3-METHYL-4,4,4-TRICHLOROBUTYRIC BETA-LACTONE Preparation Products And Raw materials |
|