| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Methyl (R)-(+)-3-hydroxy-5-oxo-1-cyclopentene-1-heptanoate Basic information |
| | Methyl (R)-(+)-3-hydroxy-5-oxo-1-cyclopentene-1-heptanoate Chemical Properties |
| Melting point | 59-63 °C(lit.) | | alpha | 10 º (C=1 IN CHLOROFORM) | | Boiling point | 378.4±42.0 °C(Predicted) | | density | 1.125±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Methanol (Slightly, Sonicated) | | pka | 12.95±0.40(Predicted) | | form | Solid | | color | Light Beige | | Optical Rotation | [α]23/D +10°, c = 1 in chloroform | | Stability: | Hygroscopic | | InChI | InChI=1S/C13H20O4/c1-17-13(16)7-5-3-2-4-6-10-8-11(14)9-12(10)15/h8,11,14H,2-7,9H2,1H3/t11-/m0/s1 | | InChIKey | PQKUWAVOSCVDCT-NSHDSACASA-N | | SMILES | C1(CCCCCCC(OC)=O)C(=O)C[C@@H](O)C=1 |
| | Methyl (R)-(+)-3-hydroxy-5-oxo-1-cyclopentene-1-heptanoate Usage And Synthesis |
| Uses | Misoprostol is reported to be as an ingredient of (+)-norprostol. Misoprostol is developed for the treatment of peptic ulcer disease. | | Synthesis Reference(s) | Synthesis, p. 781, 1986 DOI: 10.1055/s-1986-31779 |
| | Methyl (R)-(+)-3-hydroxy-5-oxo-1-cyclopentene-1-heptanoate Preparation Products And Raw materials |
|