| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (-)-beta-Chamigrene Basic information |
| Product Name: | (-)-beta-Chamigrene | | Synonyms: | (R)-3,7,7-Trimethyl-11-methylenespiro[5.5]undec-2-ene;(R)-3,7,7-Trimethyl-11-methylenespiro[5.5]undeca-2-ene;[R,(-)]-3,7,7-Trimethyl-11-methylenespiro[5.5]undeca-2-ene;Spiro[5.5]undec-2-ene, 3,7,7-trimethyl-11-methylene-, (R)-;(-)-beta-Chamigrene technical, ~90% (sum of enantiomers, GC);3,7,7-Trimethyl-11-methylenespiro[5.5]undec-2-ene;Chamigren;Spiro[5.5]undec-2-ene, 3,7,7-trimethyl-11-methylene-, (6R)- | | CAS: | 18431-82-8 | | MF: | C15H24 | | MW: | 204.35 | | EINECS: | | | Product Categories: | | | Mol File: | 18431-82-8.mol |  |
| | (-)-beta-Chamigrene Chemical Properties |
| Boiling point | 273.2±20.0 °C(Predicted) | | density | 0.89±0.1 g/cm3(Predicted) | | refractive index | n20/D 1.511 | | storage temp. | 2-8°C | | Optical Rotation | [α]20/D -77±3°, c =1% in chloroform | | InChI | 1S/C15H24/c1-12-7-10-15(11-8-12)13(2)6-5-9-14(15,3)4/h7H,2,5-6,8-11H2,1,3-4H3/t15-/m0/s1 | | InChIKey | WLNGPDPILFYWKF-HNNXBMFYSA-N | | SMILES | CC1=CC[C@]2(CC1)C(=C)CCCC2(C)C | | LogP | 6.217 (est) |
| WGK Germany | 3 | | F | 10-23 | | Storage Class | 12 - Non Combustible Liquids |
| | (-)-beta-Chamigrene Usage And Synthesis |
| Definition | ChEBI: The (6R)-enantiomer of beta-chamigrene. |
| | (-)-beta-Chamigrene Preparation Products And Raw materials |
|