| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
5-(4-Chlorophenyl)-2 4-dihydro-1 2 4-tr& manufacturers
|
| | 5-(4-Chlorophenyl)-2 4-dihydro-1 2 4-tr& Basic information |
| Product Name: | 5-(4-Chlorophenyl)-2 4-dihydro-1 2 4-tr& | | Synonyms: | s-Triazole-3-thiol, 5-(p-chlorophenyl)-;5-(p-chlorophenyl)-s-triazole-3-thio;5-(p-chlorophenyl)-s-triazole-3-thiol;Chlorophenyltriazolethiol;5-(4-Chlorophenyl)-2,4-dihydro-[1,2,4]-triazole-3-thiol;5-(4-Chloro-phenyl)-1H-[1,2,4]triazole-3-thiol;4H-1,2,4-triazole-3-thiol, 5-(4-chlorophenyl)-;5-(4-chloro-phenyl)-1,2-dihydro-[1,2,4]triazole-3-thione | | CAS: | 26028-65-9 | | MF: | C8H6ClN3S | | MW: | 211.67 | | EINECS: | 247-404-5 | | Product Categories: | TriazolesBuilding Blocks;Halogenated Heterocycles;Heterocyclic Building Blocks;Triazoles | | Mol File: | 26028-65-9.mol |  |
| | 5-(4-Chlorophenyl)-2 4-dihydro-1 2 4-tr& Chemical Properties |
| Melting point | 295-299 °C(lit.) | | Boiling point | 296.8±42.0 °C(Predicted) | | density | 1.55±0.1 g/cm3(Predicted) | | pka | 8.21±0.20(Predicted) | | form | solid | | color | White to light yellow | | InChI | InChI=1S/C8H6ClN3S/c9-6-3-1-5(2-4-6)7-10-8(13)12-11-7/h1-4H,(H2,10,11,12,13) | | InChIKey | NHEHIODVWGKDFV-UHFFFAOYSA-N | | SMILES | N1C(C2=CC=C(Cl)C=C2)=NC(=S)N1 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 13 - Non Combustible Solids |
| | 5-(4-Chlorophenyl)-2 4-dihydro-1 2 4-tr& Usage And Synthesis |
| Uses | DCN1-UBC12-IN-4 (compound 5p) is an inhibitor of DCN1-UBC12, with an IC50 greater than 10000 nM, and it exhibits anti-tumor activity[1]. | | Definition | ChEBI: 5-(4-chlorophenyl)-1,2-dihydro-1,2,4-triazole-3-thione is a member of triazoles. | | References | [1] Wenjuan Zhou, et al. Development of phenyltriazole thiol-based derivatives as highly potent inhibitors of DCN1-UBC12 interaction. Eur J Med Chem. 2021 May 5:217:113326. DOI:10.1016/j.ejmech.2021.113326 |
| | 5-(4-Chlorophenyl)-2 4-dihydro-1 2 4-tr& Preparation Products And Raw materials |
|