| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:5-[2-Chloro-5-(trifluoroMethyl)phenyl]furfural
CAS:259196-40-2
Purity:97% Package:1G,5G
|
|
| | 5-[2-Chloro-5-(trifluoromethyl)phenyl]furfural Basic information |
| Product Name: | 5-[2-Chloro-5-(trifluoromethyl)phenyl]furfural | | Synonyms: | 2-[5-[2-chloro-5-(trifluoromethyl)phenyl]-2-furanyl]acetaldehyde;5-(2-CHLORO-5-(TRIFLUOROMETHYL)PHENYL)F&;5-(2-chloro-5-(trifluoroMethyl)phenyl)furan-2-carbaldehyde;Furane-2-carboxaldehyde, 5-(2-chloro-5-trifluoromethylphenyl)-;SBB003032;ZINC00057023;447765_ALDRICH;2-Furancarboxaldehyde, 5-[2-chloro-5-(trifluoromethyl)phenyl]- | | CAS: | 259196-40-2 | | MF: | C12H6ClF3O2 | | MW: | 274.62 | | EINECS: | | | Product Categories: | API intermediates | | Mol File: | 259196-40-2.mol | ![5-[2-Chloro-5-(trifluoromethyl)phenyl]furfural Structure](CAS/GIF/259196-40-2.gif) |
| | 5-[2-Chloro-5-(trifluoromethyl)phenyl]furfural Chemical Properties |
| Melting point | 59-63 °C(lit.) | | Boiling point | 336.5±42.0 °C(Predicted) | | density | 1.410±0.06 g/cm3(Predicted) | | InChI | 1S/C12H6ClF3O2/c13-10-3-1-7(12(14,15)16)5-9(10)11-4-2-8(6-17)18-11/h1-6H | | InChIKey | BDUFOVWZBTVLPY-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1ccc(Cl)c(c1)-c2ccc(C=O)o2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2932190090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-[2-Chloro-5-(trifluoromethyl)phenyl]furfural Usage And Synthesis |
| | 5-[2-Chloro-5-(trifluoromethyl)phenyl]furfural Preparation Products And Raw materials |
|