|
|
| | 1,3-Diphenyl-1H-pyrazole-4-carbaldehyde Basic information |
| Product Name: | 1,3-Diphenyl-1H-pyrazole-4-carbaldehyde | | Synonyms: | 1H-Pyrazole-4-carboxaldehyde, 1,3-diphenyl-;1,3-DIPHENYL-1H-PYRAZOLE-4-CARBOXALDEHY&;1,3-Diphenyl-1H-pyrazole-4-carboxaldehyde;1,3-diphenyl-1H-pyrazole-4-carbaldehyde(SALTDATA: FREE);1,3-Diphenylpyrazole-4-carboxaldehyde;1,3-Diphenyl-1H-pyrazole-4-carboxaldehyde 97%;1,3-di(phenyl)-4-pyrazolecarboxaldehyde;1,3-di(phenyl)pyrazole-4-carbaldehyde | | CAS: | 21487-45-6 | | MF: | C16H12N2O | | MW: | 248.28 | | EINECS: | | | Product Categories: | Building Blocks;Heterocyclic Building Blocks;Pyrazoles | | Mol File: | 21487-45-6.mol |  |
| | 1,3-Diphenyl-1H-pyrazole-4-carbaldehyde Chemical Properties |
| Melting point | 142-146 °C | | Boiling point | 442.2±33.0 °C(Predicted) | | density | 1.14±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -2.97±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C16H12N2O/c19-12-14-11-18(15-9-5-2-6-10-15)17-16(14)13-7-3-1-4-8-13/h1-12H | | InChIKey | LZGBMIZREYTWRI-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1cn(nc1-c2ccccc2)-c3ccccc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-41-37/38 | | Safety Statements | 26-36/37/39-39 | | WGK Germany | 3 | | HS Code | 2933199090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | 1,3-Diphenyl-1H-pyrazole-4-carbaldehyde Usage And Synthesis |
| Uses | 1,3-Diphenyl-4-pyrazolecarboxaldehyde is used in thesynthesis of asymmetric thiazolyl pyrazolines as a potential antioxidant and anti-Inflammatory agents. |
| | 1,3-Diphenyl-1H-pyrazole-4-carbaldehyde Preparation Products And Raw materials |
|