|
|
| | 5-Amino-2,4,6-triiodo-N-methylisophthalamic Acid Basic information |
| Product Name: | 5-Amino-2,4,6-triiodo-N-methylisophthalamic Acid | | Synonyms: | 5-Amino-3-carboxy-2,4,6-triiodo-N-methyl-benzamide;5-AMINO-2,4,6-TRIIODO-N-METHYLISOPHTHALAMIC ACID (50 MG);3-amino-2,4,6-triiodo-5-[(methylamino)carbonyl]benzoic acid;5-Amino-2,4,6-triiodo-3-(methylaminocarbonyl)benzoic acid;3-amino-2,4,6-triiodo-5-(methylcarbamoyl)benzoic acid;3-azanyl-2,4,6-triiodo-5-(methylcarbamoyl)benzoic acid;Benzoic acid, 3-amino-2,4,6-triiodo-5-[(methylamino)carbonyl]-;5-Amino-2,4,6-triiodo-N-methylisophthalamic acid | | CAS: | 2280-89-9 | | MF: | C9H7I3N2O3 | | MW: | 571.88 | | EINECS: | 218-917-1 | | Product Categories: | Aromatics, Miscellaneous Reagents | | Mol File: | 2280-89-9.mol |  |
| | 5-Amino-2,4,6-triiodo-N-methylisophthalamic Acid Chemical Properties |
| Melting point | 266-268 °C | | Boiling point | 454.0±45.0 °C(Predicted) | | density | 2.712±0.06 g/cm3(Predicted) | | pka | 1.15±0.10(Predicted) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C9H7I3N2O3/c1-14-8(15)2-4(10)3(9(16)17)6(12)7(13)5(2)11/h13H2,1H3,(H,14,15)(H,16,17) | | InChIKey | AKXKBAWZIVNNJR-UHFFFAOYSA-N | | SMILES | Ic1c(c(c(c(c1C(=O)NC)I)C(=O)O)I)N |
| WGK Germany | WGK 3 | | HS Code | 2924296000 | | Storage Class | 11 - Combustible Solids |
| | 5-Amino-2,4,6-triiodo-N-methylisophthalamic Acid Usage And Synthesis |
| Chemical Properties | Crystallization. Melting point. 258-263℃ (decomposition). | | Uses | 5-Amino-2,4,6-triiodo-N-methylisophthalamic Acid is used in x-ray diagnosis. Used in the preparation of Iothalamic acid (I736200). |
| | 5-Amino-2,4,6-triiodo-N-methylisophthalamic Acid Preparation Products And Raw materials |
|