| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
4-O-Benzyl-D-glucal, manufacturers
- 4-O-Benzyl-D-glucal
-
-
2026-09-16
- CAS:58871-11-7
- Min. Order: 10G
- Purity: 98%min
- Supply Ability: 30kg/month
|
| | 4-O-Benzyl-D-glucal, Basic information |
| | 4-O-Benzyl-D-glucal, Chemical Properties |
| Melting point | 99-103 °C(lit.) | | Optical Rotation | [α]20/D +10°, c = 1 in chloroform | | InChI | 1S/C13H16O4/c14-8-12-13(11(15)6-7-16-12)17-9-10-4-2-1-3-5-10/h1-7,11-15H,8-9H2/t11-,12-,13+/m1/s1 | | InChIKey | OIWQZGBSQDJVJN-UPJWGTAASA-N | | SMILES | C[C@H]1OC=C[C@@H](O)[C@@H]1OCc2ccccc2 | | CAS DataBase Reference | 58871-11-7 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 4-O-Benzyl-D-glucal, Usage And Synthesis |
| | 4-O-Benzyl-D-glucal, Preparation Products And Raw materials |
|