| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | S(-)-1-(9-fluorenyl)ethanol Basic information |
| Product Name: | S(-)-1-(9-fluorenyl)ethanol | | Synonyms: | 9H-Fluorene-9-methanol, α-methyl-, (αS)-;(S)-(-)-1-(9-Fluorenyl)ethanol >=99.0% (HPLC);(-)-1-(9-Fluorenyl)ethanol;(S)-1-(9H-fluoren-9-yl)ethanol;(S)-(?)-1-(9-Fluorenyl)ethanol;S(-)-1-(9-fluorenyl)ethanol | | CAS: | 151775-20-1 | | MF: | C15H14O | | MW: | 210.27 | | EINECS: | | | Product Categories: | | | Mol File: | 151775-20-1.mol |  |
| | S(-)-1-(9-fluorenyl)ethanol Chemical Properties |
| Melting point | 100-102 °C | | Boiling point | 367.624±11.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.159±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 13.750±0.20(predicted) | | InChI | 1S/C15H14O/c1-10(16)15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)15/h2-10,15-16H,1H3/t10-/m0/s1 | | InChIKey | YSCDFPXLCCWBIS-JTQLQIEISA-N | | SMILES | C[C@H](O)C1C2=C(C=CC=C2)C3=C1C=CC=C3 |
| WGK Germany | 3 | | F | 10-23 | | Storage Class | 13 - Non Combustible Solids |
| | S(-)-1-(9-fluorenyl)ethanol Usage And Synthesis |
| Uses | (-)-1-(9-Fluorenyl)ethanol is an analytical reagent used in the separation of enantiomers of α-hydroxy acids by reversed-phase liquid chromatography after derivatization with 1-(9-fluorenyl)ethyl chloroformate. |
| | S(-)-1-(9-fluorenyl)ethanol Preparation Products And Raw materials |
|