| Company Name: |
Shanghai Holy Biohemdeviser Co., Ltd
|
| Tel: |
021-61551100 |
| Email: |
|
| Products Intro: |
Product Name:(S)-(-)-1-(9-Fluorenyl)ethanol
CAS:151775-20-1
Purity:98% HPLC; EE>98% Package:25KG;5Kg;1KG;500G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(S)-(-)-1-(9-Fluorenyl)ethanol
CAS:151775-20-1
Purity:>=99.0% (HPLC) Package:100MG Remarks:00925-100MG
|
| Company Name: |
Bejing Famous Pharmaceutical Technology Co., Ltd.
|
| Tel: |
13331045123 |
| Email: |
2559355526@qq.com |
| Products Intro: |
Product Name:(S)-1-(9H-fluoren-9-yl)ethanol
CAS:151775-20-1
Purity:97% Package:1g;5g;10g;25g;50g;100g;250g;500g;1kg;5kg;10kg;25kg;50kg;100kg;250kg;500kg
|
| Company Name: |
Shenzhen Botel Biotechnology Co. Ltd.
|
| Tel: |
13316949107 13316968096 |
| Email: |
1979313431@qq.com |
| Products Intro: |
Product Name:(-)-1-(9-Fluorenyl)ethanol
CAS:151775-20-1
Purity:98% HPLC Package:10mg;25mg;50mg
|
| Company Name: |
Shanghai Anhua Biotechnology Co., Ltd.
|
| Tel: |
021-61263375 18168859245 |
| Email: |
|
| Products Intro: |
Product Name:(S)-(-)-1-(9-fluorenyl)ethanol
CAS:151775-20-1
Purity:95%;98%;99% Package:0.1g;0.5g;1g;5g;25g;100g;1kg;5kg
|
|
| | S(-)-1-(9-FLUORENYL)ETHANOL Basic information |
| Product Name: | S(-)-1-(9-FLUORENYL)ETHANOL | | Synonyms: | S(-)-1-(9-FLUORENYL)ETHANOL;9H-Fluorene-9-methanol, α-methyl-, (αS)-;(S)-(-)-1-(9-Fluorenyl)ethanol >=99.0% (HPLC);(-)-1-(9-Fluorenyl)ethanol;(S)-1-(9H-fluoren-9-yl)ethanol;(S)-(?)-1-(9-Fluorenyl)ethanol | | CAS: | 151775-20-1 | | MF: | C15H14O | | MW: | 210.27 | | EINECS: | | | Product Categories: | | | Mol File: | 151775-20-1.mol |  |
| | S(-)-1-(9-FLUORENYL)ETHANOL Chemical Properties |
| InChI | 1S/C15H14O/c1-10(16)15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)15/h2-10,15-16H,1H3/t10-/m0/s1 | | InChIKey | YSCDFPXLCCWBIS-JTQLQIEISA-N | | SMILES | C[C@H](O)C1C2=C(C=CC=C2)C3=C1C=CC=C3 |
| WGK Germany | 3 | | F | 10-23 | | Storage Class | 13 - Non Combustible Solids |
| | S(-)-1-(9-FLUORENYL)ETHANOL Usage And Synthesis |
| Uses | (-)-1-(9-Fluorenyl)ethanol is an analytical reagent used in the separation of enantiomers of α-hydroxy acids by reversed-phase liquid chromatography after derivatization with 1-(9-fluorenyl)ethyl chloroformate. |
| | S(-)-1-(9-FLUORENYL)ETHANOL Preparation Products And Raw materials |
|