|
|
| | (+)-Bis[(R)-1-phenylethyl]amine Basic information |
| Product Name: | (+)-Bis[(R)-1-phenylethyl]amine | | Synonyms: | (+)-Bis[(R)-1-phenylethyl]amine, ChiPros;[R-(R*,R*)]-(+)-Bis(α-methylbenzyl)amine;(+)-Bis[(R)-1-phenylethyl]amine;(+)-Bis[(R)-1-phenylethyl]aMine, ChiPros|r, 99%, ee 98+%;(R)-bis((R)-1-phenylethyl)aMine;(+)-Bis[(R)-1-phenylethyl]amine 99%;(+)-BIS (R)-1-PHENYLETHYL!AMINE HYDRO-;(+)-Bis[(R)-1-phenylethyl]amine, 99% (99+% EE/GLC) | | CAS: | 23294-41-9 | | MF: | C16H19N | | MW: | 225.34 | | EINECS: | | | Product Categories: | | | Mol File: | 23294-41-9.mol | ![(+)-Bis[(R)-1-phenylethyl]amine Structure](CAS/GIF/23294-41-9.gif) |
| | (+)-Bis[(R)-1-phenylethyl]amine Chemical Properties |
| Melting point | ~260 °C | | alpha | 199 º (NEAT) | | Boiling point | 86 °C0.05 mm Hg(lit.) | | density | 0.985 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5523(lit.) | | Fp | >230 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 8.79±0.29(Predicted) | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | [α]20/D +199.0°, neat | | Water Solubility | Insoluble in water. | | BRN | 3590931 | | InChI | 1S/C16H19N/c1-13(15-9-5-3-6-10-15)17-14(2)16-11-7-4-8-12-16/h3-14,17H,1-2H3/t13-,14-/m1/s1 | | InChIKey | NXLACVVNHYIYJN-ZIAGYGMSSA-N | | SMILES | C[C@@H](N[C@H](C)c1ccccc1)c2ccccc2 | | CAS DataBase Reference | 23294-41-9 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | F | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (+)-Bis[(R)-1-phenylethyl]amine Usage And Synthesis |
| Uses | (+)-Bis[(R)-1-phenylethyl]amine play a very extensive role of making chirally optically active drugs and compounds. Also as intermediates. | | Uses | (+)-Bis[(R)-1-phenylethyl]amine can be used:
- In the synthesis ofβ-amino acids.
- In the preparation of chiral C(19)-C(26) and C(27)-C(32) moieties of scytophycin C.
- To induce enantioselectivity in the deprotonation of prochiral ketones.
- As a starting material for the synthesis of chiral phenolate ligands through Mannich condensation reaction.
- In the synthesis of chiral phosphoramidite ligands.
- To prepare chiral cyclic isoimidium salts, which are further used to synthesize chiral lactones through Diels-Alder reaction.
|
| | (+)-Bis[(R)-1-phenylethyl]amine Preparation Products And Raw materials |
|