| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | Tris(hydroxy-D-methyl)amino-d2-methane, 98 atom % D Basic information |
| | Tris(hydroxy-D-methyl)amino-d2-methane, 98 atom % D Chemical Properties |
| Melting point | 170-171 °C(lit.) | | form | solid | | PH | 10.5-12 | | InChI | 1S/C4H11NO3/c5-4(1-6,2-7)3-8/h6-8H,1-3,5H2/i6D,7D,8D/hD2 | | InChIKey | LENZDBCJOHFCAS-FUPCUYIQSA-N | | SMILES | [2H]OCC(CO[2H])(CO[2H])N([2H])[2H] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Tris(hydroxy-D-methyl)amino-d2-methane, 98 atom % D Usage And Synthesis |
| | Tris(hydroxy-D-methyl)amino-d2-methane, 98 atom % D Preparation Products And Raw materials |
|