|
|
| | 2-METHYL-4-NITROBENZONITRILE 98 Basic information |
| | 2-METHYL-4-NITROBENZONITRILE 98 Chemical Properties |
| Melting point | 100-103 °C(lit.) | | Boiling point | 329.6±30.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow to Light orange | | InChI | 1S/C8H6N2O2/c1-6-4-8(10(11)12)3-2-7(6)5-9/h2-4H,1H3 | | InChIKey | RNTFKDBRMXYEPR-UHFFFAOYSA-N | | SMILES | Cc1cc(ccc1C#N)[N+]([O-])=O | | CAS DataBase Reference | 89001-53-6 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2926907090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-METHYL-4-NITROBENZONITRILE 98 Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde |
| | 2-METHYL-4-NITROBENZONITRILE 98 Preparation Products And Raw materials |
|