| Company Name: |
Shandong Xiya Chemical Co., Ltd
|
| Tel: |
13355009207 13355009207 |
| Email: |
3007715519@qq.com |
| Products Intro: |
CAS:20782-57-4
Purity:>=98.0% Package:1ml
|
| Company Name: |
TianJin Alta Scientific Co., Ltd.
|
| Tel: |
022-65378550-8551 |
| Email: |
contact@altascientific.com |
| Products Intro: |
Product Name:Metoxuron-MonoMethyl
CAS:20782-57-4
Purity:98% Package:10Mg 25Mg 100Mg
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Metoxuron-monomethyl
CAS:20782-57-4
Purity:99% Package:10mg;100mg;1g
|
|
| | METOXURON-MONOMETHYL Basic information |
| Product Name: | METOXURON-MONOMETHYL | | Synonyms: | Metoxuron-monomethyl, 10 μg /μL in Ethyl acetate;Metoxuron-Monomethyl-D3;Urea, N-(3-chloro-4-methoxyphenyl)-N'-methyl-;1-(3-chloro-4-methoxyphenyl)-3-methylurea | | CAS: | 20782-57-4 | | MF: | C9H11ClN2O2 | | MW: | 214.65 | | EINECS: | | | Product Categories: | | | Mol File: | 20782-57-4.mol |  |
| | METOXURON-MONOMETHYL Chemical Properties |
| InChI | InChI=1S/C9H11ClN2O2/c1-11-9(13)12-6-3-4-8(14-2)7(10)5-6/h3-5H,1-2H3,(H2,11,12,13) | | InChIKey | YWHRNWZTCCNWSH-UHFFFAOYSA-N | | SMILES | N(C1=CC=C(OC)C(Cl)=C1)C(NC)=O |
| | METOXURON-MONOMETHYL Usage And Synthesis |
| Definition | ChEBI: 3-(3-chloro-4-methoxylphenyl)-1-methylurea is an a 1-methyl-3-phenylurea. |
| | METOXURON-MONOMETHYL Preparation Products And Raw materials |
|