3-chloro-1-(1,1-dimethylethyl)Naphthalene manufacturers
|
| | 3-chloro-1-(1,1-dimethylethyl)Naphthalene Basic information |
| | 3-chloro-1-(1,1-dimethylethyl)Naphthalene Chemical Properties |
| Boiling point | 300.1±11.0 °C(Predicted) | | density | 1.081±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C14H15Cl/c1-14(2,3)13-9-11(15)8-10-6-4-5-7-12(10)13/h4-9H,1-3H3 | | InChIKey | ALECXKNDPPUBFP-UHFFFAOYSA-N | | SMILES | C1(C(C)(C)C)=C2C(C=CC=C2)=CC(Cl)=C1 |
| | 3-chloro-1-(1,1-dimethylethyl)Naphthalene Usage And Synthesis |
| Uses | 3-chloro-1-(1,1-dimethylethyl)Naphthalene, also known as 1-(tert-butyl)-3-chloronaphthalene, is a key intermediate in the synthesis process of organic electroluminescent diodes (OLED) molecular materials. | | Preparation | In a three-neck flask, the catalyst ligand 1-(2-carboxyethyl)-3-formyltriacyl-1H-imidazol-3-ammonium chloride (1.03 mmol), nickel acetylacetonate (1.01 mmol), and lithium tert-butoxide (31.2 mmol) were added to tetrahydrofuran (100 mL). Isopropyl magnesium chloride (14.6 mL, 1.7 M ether solution, 24.8 mmol) was subsequently added under nitrogen protection and agitation. Add 1-bromo-3-chloronaphthalene after 0.5 h and stir at 0 °C for 2 h. Finally, 3-chloro-1-(1,1-dimethylethyl)Naphthalene was obtained after purification.
 |
| | 3-chloro-1-(1,1-dimethylethyl)Naphthalene Preparation Products And Raw materials |
|