3,5-Bis(4-aminophenoxy)benzoic acid manufacturers
|
| | 3,5-Bis(4-aminophenoxy)benzoic acid Basic information |
| | 3,5-Bis(4-aminophenoxy)benzoic acid Chemical Properties |
| Melting point | 240 °C | | Boiling point | 583.2±50.0 °C(Predicted) | | density | 1.357±0.06 g/cm3(Predicted) | | solubility | almost transparency in Acetone | | form | powder to crystal White to Amber | | pka | 3.66±0.10(Predicted) | | InChI | InChI=1S/C19H16N2O4/c20-13-1-5-15(6-2-13)24-17-9-12(19(22)23)10-18(11-17)25-16-7-3-14(21)4-8-16/h1-11H,20-21H2,(H,22,23) | | InChIKey | KPKOSOUTWDOOIW-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(OC2=CC=C(N)C=C2)=CC(OC2=CC=C(N)C=C2)=C1 | | CAS DataBase Reference | 195189-45-8 |
| | 3,5-Bis(4-aminophenoxy)benzoic acid Usage And Synthesis |
| | 3,5-Bis(4-aminophenoxy)benzoic acid Preparation Products And Raw materials |
|