| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-(3-Hydroxyphenyl)-2-nitroethene Basic information |
| Product Name: | 1-(3-Hydroxyphenyl)-2-nitroethene | | Synonyms: | TRANS-3-HYDROXY-BETA-NITROSTYRENE;1-HYDROXY-3-(2-NITROVINYL)BENZENE;3-(2-NITRO-VINYL)-PHENOL;2-(3-HYDROXYPHENYL)NITROETHENE;3'-HYDROXY-BETA-NITROSTYRENE;3-HYDROXY-BETA-NITROSTYRENE;trans-3-hydroxy-β-nitrostyrene;1-Hydroxy-3-(2-nitrovinyl)benzene, 2-(3-Hydroxyphenyl)nitroethene, trans-3-(2-Nitrovinyl)phenol | | CAS: | 3156-44-3 | | MF: | C8H7NO3 | | MW: | 165.15 | | EINECS: | | | Product Categories: | Ethanes/ethenes;Styrenes | | Mol File: | 3156-44-3.mol |  |
| | 1-(3-Hydroxyphenyl)-2-nitroethene Chemical Properties |
| Melting point | 136-140 °C (lit.) | | form | solid | | InChI | 1S/C8H7NO3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-6,10H/b5-4+ | | InChIKey | DHTXBJQMDPODIB-SNAWJCMRSA-N | | SMILES | [H]\C(=C(\[H])[N+]([O-])=O)c1cccc(O)c1 |
| Hazard Codes | Xn,N | | Risk Statements | 22-36/38-50 | | Safety Statements | 26-36/37-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | HS Code | 2906290090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Eye Irrit. 2
Skin Irrit. 2 |
| | 1-(3-Hydroxyphenyl)-2-nitroethene Usage And Synthesis |
| | 1-(3-Hydroxyphenyl)-2-nitroethene Preparation Products And Raw materials |
|