- MNS
-
- $43.00
-
2026-07-27
- CAS:1485-00-3
- Purity: 98.53%
- Supply Ability: 10g
|
| | 3,4-Methylenedioxy-beta-nitrostyrene Basic information |
| Product Name: | 3,4-Methylenedioxy-beta-nitrostyrene | | Synonyms: | 3,4-methylenedioxy-beta-nitro-styren;3,4-Methylenedioxy-omega-nitrostyrene;5-[(E)-2-Nitroethenyl]-1,3-benzodioxole;5-nitrovinyl-3-benzodioxole;Benzene, 2-nitroethenyl, 3,4-methylenedioxy;Ethene,-1-(3,4-methylendioxyphenyl)-2-nitro-;Styrene, 3,4-methylenedioxy-beta-nitro-;tyrene, 3,4-(methylenedioxy)-b-nitro- | | CAS: | 1485-00-3 | | MF: | C9H7NO4 | | MW: | 193.16 | | EINECS: | 622-830-8 | | Product Categories: | Ethanes/ethenes;Inhibitors | | Mol File: | 1485-00-3.mol |  |
| | 3,4-Methylenedioxy-beta-nitrostyrene Chemical Properties |
| Melting point | 159-163 °C | | Boiling point | 329.36°C (rough estimate) | | density | 1.4058 (rough estimate) | | refractive index | 1.5200 (estimate) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in DMSO (up to 50 mg/ml). | | form | Yellow to brown solid | | color | Yellow | | Sensitive | Light Sensitive | | BRN | 192350 | | Stability: | Stable for 2 years from date of purchase as supplied. Solutions in DMSO may be stored at -20° for up to 1 month. | | InChI | InChI=1S/C9H7NO4/c11-10(12)4-3-7-1-2-8-9(5-7)14-6-13-8/h1-5H,6H2 | | InChIKey | KFLWBZPSJQPRDD-UHFFFAOYSA-N | | SMILES | O1C2=CC=C(C=C[N+]([O-])=O)C=C2OC1 | | CAS DataBase Reference | 1485-00-3(CAS DataBase Reference) | | NIST Chemistry Reference | 3,4-Methylenedioxy-«beta»-nitrostyrene(1485-00-3) |
| Hazard Codes | Xn,Xi,T | | Risk Statements | 36/37/38-22-25 | | Safety Statements | 36/37/39-26-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | WGK 3 | | RTECS | WL5270000 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | 3,4-Methylenedioxy-beta-nitrostyrene Usage And Synthesis |
| Description | MDBN (1485-00-3) is an irreversible inhibitor of p97 (IC50 < 10 μM). Cell permeable. | | Chemical Properties | yellow powder | | Uses | MDBN is a Src and Syk kinase inhibitor that prevents phosphorylation and cytoskeletal association of GPIIb/IIIa and talin. | | Biological Activity | Selective inhibitor of Src and Syk tyrosine kinases. Displays antiaggregative activity via inhibition of GPIIb/IIIa activation (IC 50 = 12.7 μ M for thrombin-induced platelet aggregation). Exhibits no effects on Ca 2+ -dependent enzymes, PKC or arachidonic acid metabolism. | | in vivo | MNS (20 mg/kg, i.p.) ameliorates experimental burn wound progression in Wistar rats by inhibiting the NLRP3 inflammasome activation[7].
MNS (30 mg/kg, p.o., 5 days) alleviates DSS-induced mouse colitis by inhibiting the NLRP3 inflammasome[8].
MNS (20mg/kg, i.p., 30min before reperfusion) significantly protects the kidneys from RIR injury in rats by reducing PANoptosis through specific inhibition of NLRP3[9].
| | IC 50 | NLRP3 inflammasome | | References | [1] TSUI-FEN CHOU R J D. Quantitative cell-based protein degradation assays to identify and classify drugs that target the ubiquitin-proteasome system.[J]. The Journal of Biological Chemistry, 2011, 286 19: 16546-16554. DOI:10.1074/jbc.m110.215319 |
| | 3,4-Methylenedioxy-beta-nitrostyrene Preparation Products And Raw materials |
|