|
|
| | 2-Bromoethanol-1,1,2,2-d4 Basic information |
| Product Name: | 2-Bromoethanol-1,1,2,2-d4 | | Synonyms: | 2-BROMOETHANOL-1,1,2,2-D4, 98 ATOM % D;Ethan-1,1,2,2-d4-ol, 2-bromo-;ethylene-d4bromohydrin;2-Bromoethanol-d4;2-bromoethyl alcohol D4;2-BROMOETHANOL (1,1,2,2-D4, 98%);2-bromo-1,1,2,2-tetradeuterioethanol;Deuterated 2-bromoethanol | | CAS: | 81764-55-8 | | MF: | C2HBrD4O | | MW: | 128.99 | | EINECS: | | | Product Categories: | | | Mol File: | 81764-55-8.mol |  |
| | 2-Bromoethanol-1,1,2,2-d4 Chemical Properties |
| Boiling point | 56-57 °C20 mm Hg(lit.) | | density | 1.819 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.493(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | soluble in Chloroform, Methanol | | form | Liquid | | color | Colourless to Pale Yellow | | InChI | 1S/C2H5BrO/c3-1-2-4/h4H,1-2H2/i1D2,2D2 | | InChIKey | LDLCZOVUSADOIV-LNLMKGTHSA-N | | SMILES | [2H]C([2H])(O)C([2H])([2H])Br | | CAS Number Unlabeled | 540-51-2 |
| Hazard Codes | T+ | | Risk Statements | 26/27/28-34-40 | | Safety Statements | 23-36/37/39-45 | | RIDADR | UN 2922 8/PG 2 | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Dam. 1 Skin Corr. 1B |
| | 2-Bromoethanol-1,1,2,2-d4 Usage And Synthesis |
| Uses | 2-BROMOETHANOL-1,1,2,2-D4 is an widely used intermediate in organic synthesis. |
| | 2-Bromoethanol-1,1,2,2-d4 Preparation Products And Raw materials |
|