| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Ethyl 4-(benzyloxy)benzoate Basic information |
| Product Name: | Ethyl 4-(benzyloxy)benzoate | | Synonyms: | RARECHEM AL BI 0087;4-(BENZYLOXY)BENZOIC ACID ETHYL ESTER;benzoic acid, 4-(phenylmethoxy)-, ethyl ester;JR-8796, Ethyl 4-(benzyloxy)benzoate, 97%;[4-[[4-amino-6-(1-piperidinyl)-1,3,5-triazin-2-yl]methyl]-1-piperazinyl]-phenylmethanone;Ethyl 4-(benzyloxy)benzoate | | CAS: | 56441-55-5 | | MF: | C16H16O3 | | MW: | 256.3 | | EINECS: | | | Product Categories: | Aromatic Esters | | Mol File: | 56441-55-5.mol |  |
| | Ethyl 4-(benzyloxy)benzoate Chemical Properties |
| Melting point | 42-44°C | | storage temp. | Storage temp. 2-8°C | | form | solid | | Appearance | White to light yellow Solid | | InChI | 1S/C16H16O3/c1-2-18-16(17)14-8-10-15(11-9-14)19-12-13-6-4-3-5-7-13/h3-11H,2,12H2,1H3 | | InChIKey | UMOKJIWMQFEFJE-UHFFFAOYSA-N | | SMILES | O=C(OCC)C(C=C1)=CC=C1OCC2=CC=CC=C2 | | CAS DataBase Reference | 56441-55-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 23-24/25-39-26 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| Provider | Language |
|
ALFA
| English |
| | Ethyl 4-(benzyloxy)benzoate Usage And Synthesis |
| | Ethyl 4-(benzyloxy)benzoate Preparation Products And Raw materials |
|