|
|
| | DL-threo-beta-Hydroxyaspartic acid Basic information |
| | DL-threo-beta-Hydroxyaspartic acid Chemical Properties |
| Melting point | >230°C dec | | Boiling point | 368.7±42.0 °C(Predicted) | | density | 1.738±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Aqueous Base (Slightly) | | pka | 2.13±0.27(Predicted) | | form | Solid | | color | White to Pale Beige | | Stability: | Hygroscopic | | InChI | InChI=1/C4H7NO5/c5-1(3(7)8)2(6)4(9)10/h1-2,6H,5H2,(H,7,8)(H,9,10)/t1-,2-/s3 | | InChIKey | YYLQUHNPNCGKJQ-JCYAYHJZSA-N | | SMILES | C(O)(=O)[C@@H]([C@@H](O)C(O)=O)N |&1:3,4,r| | | CAS DataBase Reference | 4294-45-5 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | DL-threo-beta-Hydroxyaspartic acid Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | A glutamate uptake inhibitor | | Uses | L-aspartate beta-carboxylase inhibitor, neurotoxic | | Uses | DL-threo-β-Hydroxyaspartic acid (THA) has been used to block glutamate transport in cannulated sprague dawley rat. | | Definition | ChEBI: (3S)-3-hydroxy-L-aspartic acid is the (3S)-diastereomer of 3-hydroxy-L-aspartic acid. It has a role as a metabolite. It is a conjugate acid of a (3S)-3-hydroxy-L-aspartate(2-) and a (3S)-3-hydroxy-L-aspartate(1-). It is an enantiomer of a (3R)-3-hydroxy-D-aspartic acid. | | General Description | DL-threo-β-hydroxyaspartic acid (THA) is a glutamate uptake inhibitor. |
| | DL-threo-beta-Hydroxyaspartic acid Preparation Products And Raw materials |
|