| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (+)-Longicyclene Basic information |
| Product Name: | (+)-Longicyclene | | Synonyms: | LONGICYCLENE, (+)-;(1S,2S)-1,2,6,6-TETRAMETHYLTETRACYCLO[8.1.0.0(2.8).0(7.11)]UNDECANE;1,2,4-Methenoazulene, decahydro-1,5,5,8a-tetramethyl-, [1S-(1alpha,2alpha,3abeta,4alpha,8abeta,9R)]-;1,2,4-Methenoazulene, decahydro-1,5,5,8a-tetramethyl-, [1S-(1alpha,2alpha,3abeta,4alpha,8abeta,9R*)]-;(+)-Longicyclene >=95.0% (sum of enantiomers, GC);[1S-(1alpha,2alpha,3abeta,4alpha,8abeta,9R*)]-decahydro-1,5,5,8a-tetramethyl-1,2,4-methenoazulene;LONGICYCLEN;C15 H24, 1,2,4-Methenoazulene, decahydro-1,5,5,8a-tetramethyl-, | | CAS: | 1137-12-8 | | MF: | C15H24 | | MW: | 204.35 | | EINECS: | 214-504-5 | | Product Categories: | | | Mol File: | 1137-12-8.mol |  |
| | (+)-Longicyclene Chemical Properties |
| Boiling point | 252-254 °C (lit.) | | density | 0.937 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.493 | | Fp | 92 °C | | form | liquid | | Optical Rotation | [α]20/D +32.5±1°, neat | | BRN | 2039581 | | InChI | 1S/C15H24/c1-13(2)6-5-7-14(3)9-8-10-12(11(9)13)15(10,14)4/h9-12H,5-8H2,1-4H3/t9-,10-,11-,12-,14+,15+/m1/s1 | | InChIKey | WCEIQUQVIOGRBF-YTDSDZJUSA-N | | SMILES | CC1(C)CCC[C@@]2(C)[C@@H]3C[C@@H]4[C@H]([C@H]13)[C@@]24C | | LogP | 5.908 (est) | | EPA Substance Registry System | Longicyclene (1137-12-8) |
| RIDADR | UN3082 - class 9 - PG 3 - DOT NA1993 - Environmentally hazardous substances, liquid, n.o.s. HI: all (not BR) | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| | (+)-Longicyclene Usage And Synthesis |
| Uses | Longicyclene is the first tetracarbocyclic sesquiterpene isolated from the essential oil of Pinus longifolia, Roxb. | | General Description | Longicyclene is the first tetracarbocyclic sesquiterpene isolated from the essential oil of Pinus longifolia, Roxb. |
| | (+)-Longicyclene Preparation Products And Raw materials |
| Preparation Products | 1,2,4-Methenoazulene-1(2H)-carboxaldehyde, octahydro-5,5,8a-trimethyl-, (1R,2S,3aR,4R,8aS,9S)-rel- |
|