| Company Name: |
Nanjing Chemlin Chemical Co., Ltd
|
| Tel: |
025-83697070 13913916777; |
| Email: |
info@chemlin.com.cn |
| Products Intro: |
Product Name:2,4-Dichloro-3-phenyl-quinoline CAS:108832-15-1 Purity:0.98 Package:5KG; 1KG
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:2,4-Dichloro-3-phenylquinoline CAS:108832-15-1 Purity:2,4-Dichloro-3-phenylquinoline Package:250MG Remarks:PH017685-250MG
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:2,4-Dichloro-3-phenylquinoline CAS:108832-15-1
|
| Company Name: |
Apollo Scientific Ltd.
|
| Tel: |
44 161 406 0505 |
| Email: |
sales@apolloscientific.co.uk |
| Products Intro: |
CAS:108832-15-1 Remarks:OR22186
|
|
| | 2,4-DICHLORO-3-PHENYLQUINOLINE Basic information |
| | 2,4-DICHLORO-3-PHENYLQUINOLINE Chemical Properties |
| form | solid | | InChI | 1S/C15H9Cl2N/c16-14-11-8-4-5-9-12(11)18-15(17)13(14)10-6-2-1-3-7-10/h1-9H | | InChIKey | AJFBGQFLYLZASL-UHFFFAOYSA-N | | SMILES | ClC1=NC2=CC=CC=C2C(Cl)=C1C3=CC=CC=C3 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | 2,4-DICHLORO-3-PHENYLQUINOLINE Usage And Synthesis |
| | 2,4-DICHLORO-3-PHENYLQUINOLINE Preparation Products And Raw materials |
|