| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2,4-Dichloro-3-phenylquinoline Basic information |
| | 2,4-Dichloro-3-phenylquinoline Chemical Properties |
| form | solid | | InChI | 1S/C15H9Cl2N/c16-14-11-8-4-5-9-12(11)18-15(17)13(14)10-6-2-1-3-7-10/h1-9H | | InChIKey | AJFBGQFLYLZASL-UHFFFAOYSA-N | | SMILES | ClC1=NC2=CC=CC=C2C(Cl)=C1C3=CC=CC=C3 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | 2,4-Dichloro-3-phenylquinoline Usage And Synthesis |
| | 2,4-Dichloro-3-phenylquinoline Preparation Products And Raw materials |
|