SCLEROTIORIN manufacturers
- Sclerotiorin
-
- $3270.00
-
2025-12-22
- CAS:549-23-5
- Purity:
- Supply Ability: 10g
|
| | SCLEROTIORIN Basic information |
| Product Name: | SCLEROTIORIN | | Synonyms: | SCLEROTIORIN;(R)-7-Acetoxy-5-chloro-3-[(S,1E,3E)-3,5-dimethyl-1,3-heptadienyl]-7-methyl-6H-2-benzopyran-6,8(7H)-dione;7-(Acetyloxy)-5-chloro-3-[(1E,3E,5S)-3,5-dimethyl-1,3-heptadien-1-yl]-7-methyl-6H-2-benzopyran-6,8(7H)-dione;(S-(R*,R*-(E,E)))-SCLEROTIORIN;6H-2-Benzopyran-6,8(7H)-dione, 7-(acetyloxy)-5-chloro-3-[(1E,3E,5S)-3,5-dimethyl-1,3-heptadien-1-yl]-7-methyl-, (7R)- | | CAS: | 549-23-5 | | MF: | C21H23ClO5 | | MW: | 390.86 | | EINECS: | | | Product Categories: | | | Mol File: | 549-23-5.mol |  |
| | SCLEROTIORIN Chemical Properties |
| Melting point | 206-207℃ | | alpha | [α]D20 +450～+550゜ (c=1, CHCl3) | | Boiling point | 482.9±45.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMF: 30 mg/ml; DMF:PBS(pH7.2) (1:2): 0.3 mg/ml; DMSO: 20 mg/ml; Ethanol: 3 mg/ml | | form | A crystalline solid | | color | Yellow | | InChI | InChI=1S/C21H23ClO5/c1-6-12(2)9-13(3)7-8-15-10-16-17(11-26-15)19(24)21(5,27-14(4)23)20(25)18(16)22/h7-12H,6H2,1-5H3/b8-7+,13-9+/t12-,21+/m0/s1 | | InChIKey | SWJLTKXURNHVHE-UPWXJBBJSA-N | | SMILES | C1(/C=C/C(/C)=C/[C@@H](C)CC)OC=C2C(=O)[C@](OC(C)=O)(C)C(=O)C(Cl)=C2C=1 |
| | SCLEROTIORIN Usage And Synthesis |
| Uses | Sclerotiorin is a natural product isolated primarily fromPenicilliumspecies. | | Definition | ChEBI: Sclerotiorin is an azaphilone. | | storage | +4°C |
| | SCLEROTIORIN Preparation Products And Raw materials |
|