| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
inquiry@bocsci.com |
|
| | Digalacturonic acid Basic information |
| Product Name: | Digalacturonic acid | | Synonyms: | A-DGALU(1-4)DGALU;(ALPHA-DGALU(1-4)DGALU);ALPHA-D-GALA-[1->4]-D-GALA;GALACTURONIC ACID ALPHA1,4-GALACTURONIC ACID;GALA-ALPHA1,4GALA;α-d-gala-(1→4)-d-gala;FURA-PE3 HEXAPOTASSIUM SALT;(2S,3R,4S,5R,6S)-6-[(2S,3R,4R,5R)-2-carboxy-4,5,6-trihydroxy-oxan-3-yl]oxy-3,4,5-trihydroxy-oxane-2-carboxylic acid | | CAS: | 5894-59-7 | | MF: | C12H18O13 | | MW: | 370.26 | | EINECS: | | | Product Categories: | | | Mol File: | 5894-59-7.mol |  |
| | Digalacturonic acid Chemical Properties |
| Melting point | >119°C (dec.) | | Boiling point | 829.5±65.0 °C(Predicted) | | density | 1.88±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | pka | 2.79±0.70(Predicted) | | form | Solid | | color | White to Off-White | | biological source | synthetic (organic) | | Water Solubility | water: 50mg/mL, clear, colorless to faintly yellow | | Stability: | Hygroscopic | | InChI | 1S/C12H18O13/c13-1-2(14)3(15)8(7(19)10(20)21)24-12-6(18)4(16)5(17)9(25-12)11(22)23/h1-9,12,14-19H,(H,20,21)(H,22,23) | | InChIKey | SYBQLSSECRIKMJ-UHFFFAOYSA-N | | SMILES | OC(C=O)C(O)C(OC1OC(C(O)C(O)C1O)C(O)=O)C(O)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Digalacturonic acid Usage And Synthesis |
| Uses | Digalacturonic Acid act as signaling molecules in plants, initiating the proteinase inhibitor genes in plants. Also used in the synthesis of adhesion inhibitors for Streptococcus. | | Definition | ChEBI: Alpha-D-GalpA-(1->4)-D-GalpA is a digalacturonic acid in which an alpha-D-galactopyranuronic acid unit is joined to a D-galactopyranuronic acid unit via an alpha-(1->4)-linkage. It is a conjugate acid of an alpha-D-galacturonosyl-(1->4)-D-galacturonate(2-). | | IC 50 | Human Endogenous Metabolite |
| | Digalacturonic acid Preparation Products And Raw materials |
|