| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Digalacturonic Acid
CAS:5894-59-7
Purity:>98% Package:100Mg,25Mg,500Mg
|
| Company Name: |
Shanghai Macklin Biochemical Co.,Ltd.
|
| Tel: |
15221275939; 15221275939 |
| Email: |
shenlinxing@macklin.cn |
| Products Intro: |
Product Name:Digalacturonic acid
CAS:5894-59-7
Purity:>=85%(HPLC) Package:5mg
|
| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:Digalacturonic Acid
CAS:5894-59-7
Purity:＞85% Package:10mg Remarks:T56433
|
|
| | DIGALACTURONIC ACID Basic information |
| Product Name: | DIGALACTURONIC ACID | | Synonyms: | A-DGALU(1-4)DGALU;(ALPHA-DGALU(1-4)DGALU);ALPHA-D-GALA-[1->4]-D-GALA;GALACTURONIC ACID ALPHA1,4-GALACTURONIC ACID;GALA-ALPHA1,4GALA;DIGALACTURONIC ACID;α-d-gala-(1→4)-d-gala;FURA-PE3 HEXAPOTASSIUM SALT | | CAS: | 5894-59-7 | | MF: | C12H18O13 | | MW: | 370.26 | | EINECS: | | | Product Categories: | | | Mol File: | 5894-59-7.mol |  |
| | DIGALACTURONIC ACID Chemical Properties |
| Melting point | >119°C (dec.) | | Boiling point | 829.5±65.0 °C(Predicted) | | density | 1.88±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | pka | 2.79±0.70(Predicted) | | form | Solid | | color | White to Off-White | | biological source | synthetic (organic) | | Water Solubility | water: 50mg/mL, clear, colorless to faintly yellow | | Stability: | Hygroscopic | | InChI | 1S/C12H18O13/c13-1-2(14)3(15)8(7(19)10(20)21)24-12-6(18)4(16)5(17)9(25-12)11(22)23/h1-9,12,14-19H,(H,20,21)(H,22,23) | | InChIKey | SYBQLSSECRIKMJ-UHFFFAOYSA-N | | SMILES | OC(C=O)C(O)C(OC1OC(C(O)C(O)C1O)C(O)=O)C(O)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | DIGALACTURONIC ACID Usage And Synthesis |
| Uses | Digalacturonic Acid act as signaling molecules in plants, initiating the proteinase inhibitor genes in plants. Also used in the synthesis of adhesion inhibitors for Streptococcus. | | Definition | ChEBI: Alpha-D-GalpA-(1->4)-D-GalpA is a digalacturonic acid in which an alpha-D-galactopyranuronic acid unit is joined to a D-galactopyranuronic acid unit via an alpha-(1->4)-linkage. It is a conjugate acid of an alpha-D-galacturonosyl-(1->4)-D-galacturonate(2-). | | IC 50 | Human Endogenous Metabolite |
| | DIGALACTURONIC ACID Preparation Products And Raw materials |
|