|
|
| | N-(5-Bromo-pyridin-3-yl)-2,2-dimethyl-propionamide Basic information |
| | N-(5-Bromo-pyridin-3-yl)-2,2-dimethyl-propionamide Chemical Properties |
| Boiling point | 365.7±27.0 °C(Predicted) | | density | 1.416±0.06 g/cm3(Predicted) | | pka | 13.52±0.70(Predicted) | | form | solid | | InChI | 1S/C10H13BrN2O/c1-10(2,3)9(14)13-8-4-7(11)5-12-6-8/h4-6H,1-3H3,(H,13,14) | | InChIKey | OKUYTVHRBWHVQU-UHFFFAOYSA-N | | SMILES | CC(C)(C)C(=O)Nc1cncc(Br)c1 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | N-(5-Bromo-pyridin-3-yl)-2,2-dimethyl-propionamide Usage And Synthesis |
| | N-(5-Bromo-pyridin-3-yl)-2,2-dimethyl-propionamide Preparation Products And Raw materials |
|