|
|
| | 1,1,2,2-Tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulphonyl fluoride Basic information |
| Product Name: | 1,1,2,2-Tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulphonyl fluoride | | Synonyms: | ETHANESULFONYL FLUORIDE, 1,1,2,2-TETRAFLUORO-2-(1,1,2,2-TETRAFLUOROETHOXY)-;5H-3-OXA-OCTAFLUOROPENTANOSULFONYL FLUORIDE;1,1,2,2-Tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonyl fluoride;5H-Octafluoro-3-oxapentanesulfonyl fluoride;1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethane-1-sulfonyl fluoride;1,1,2,2-Tetrafluoro-2-(1,1,2,2-tetrafluoroeth;1,1,2,2-Tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulphonyl fluoride | | CAS: | 104729-49-9 | | MF: | C4HF9O3S | | MW: | 300.1 | | EINECS: | | | Product Categories: | | | Mol File: | 104729-49-9.mol |  |
| | 1,1,2,2-Tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulphonyl fluoride Chemical Properties |
| Boiling point | 132.2±40.0 °C(Predicted) | | density | 1.749±0.06 g/cm3(Predicted) | | form | liquid | | color | Clear | | InChI | InChI=1S/C4HF9O3S/c5-1(6)2(7,8)16-3(9,10)4(11,12)17(13,14)15/h1H | | InChIKey | XLXYXEHVIIRCGY-UHFFFAOYSA-N | | SMILES | C(S(F)(=O)=O)(F)(F)C(F)(F)OC(F)(F)C(F)F | | EPA Substance Registry System | 1,1,2,2-Tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethane-1-sulfonyl fluoride (104729-49-9) |
| Hazard Codes | T | | HS Code | 2909199090 |
| | 1,1,2,2-Tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulphonyl fluoride Usage And Synthesis |
| Uses | 1,1,2,2-Tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulphonyl Fluoride is a useful reactant in organic synthesis. |
| | 1,1,2,2-Tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulphonyl fluoride Preparation Products And Raw materials |
|