|
|
| | 2,8-Bis(trifluoromethyl)-4-quinolyl(1-oxypyrid-2-yl) methane Basic information |
| | 2,8-Bis(trifluoromethyl)-4-quinolyl(1-oxypyrid-2-yl) methane Chemical Properties |
| Boiling point | 465.4±40.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | form | solid | | pka | 0.42±0.10(Predicted) | | InChI | 1S/C17H10F6N2O/c18-16(19,20)13-6-3-5-12-10(8-11-4-1-2-7-25(11)26)9-14(17(21,22)23)24-15(12)13/h1-7,9H,8H2 | | InChIKey | IWTFZQWLOJYLRU-UHFFFAOYSA-N | | SMILES | [O-][n+]1ccccc1Cc2cc(nc3c(cccc23)C(F)(F)F)C(F)(F)F |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 4 |
| | 2,8-Bis(trifluoromethyl)-4-quinolyl(1-oxypyrid-2-yl) methane Usage And Synthesis |
| | 2,8-Bis(trifluoromethyl)-4-quinolyl(1-oxypyrid-2-yl) methane Preparation Products And Raw materials |
|