| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-Bromoisophthalaldehyde Basic information |
| Product Name: | 5-Bromoisophthalaldehyde | | Synonyms: | 1,3-BisforMyl-5-broMobenzene;5-Bromo-1,3-benzenedicarboxaldehyde;5-bromoisophthaldehyde;5-bromobenzene-1,3-dicarbaldehyde;5-BROMOISOPHTHALALD;1,3-Benzenedicarboxaldehyde, 5-bromo-;5-BROMOISOPHTHALDEHYDE,5-Bromoisophthalaldehyde,1-bromo-3,5-dicarboxaldehyde,3,5-diformylbromobenzene,1,3-;5-Bromoisophthalaldehyde | | CAS: | 120173-41-3 | | MF: | C8H5BrO2 | | MW: | 213.03 | | EINECS: | | | Product Categories: | | | Mol File: | 120173-41-3.mol |  |
| | 5-Bromoisophthalaldehyde Chemical Properties |
| Boiling point | 307.1±27.0 °C(Predicted) | | density | 1.652±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | color | Off-white | | InChI | InChI=1S/C8H5BrO2/c9-8-2-6(4-10)1-7(3-8)5-11/h1-5H | | InChIKey | QAQOLRCTTDVBAK-UHFFFAOYSA-N | | SMILES | C1(C=C(Br)C=C(C=O)C=1)C=O |
| | 5-Bromoisophthalaldehyde Usage And Synthesis |
| Synthesis | General procedure for the synthesis of 5-bromoisophthalaldehyde from 5-bromo-1,3-dihydroxymethylbenzene: Manganese(IV) dioxide (35.5 g, 408 mmol) was added to a solution of 5-bromo-1,3-phenylenedimethanol (3.60 g, 16.6 mmol) in tetrahydrofuran (250 mL) and the reaction was heated for 4 hr at 60 °C. Upon completion of the reaction, the reaction mixture was filtered through diatomaceous earth and the filtrate was concentrated under reduced pressure to remove the solvent. The final 5-bromoisophthalaldehyde (1.61 g, 46% yield) was obtained as a white solid. | | References | [1] Tetrahedron Letters, 2000, vol. 41, # 7, p. 1015 - 1018
[2] Synthesis, 1998, # 12, p. 1742 - 1749
[3] Chemische Berichte, 1989, vol. 122, p. 1365 - 1372
[4] New Journal of Chemistry, 2009, vol. 33, # 2, p. 345 - 357
[5] Patent: JP2015/224231, 2015, A. Location in patent: Paragraph 0071 |
| | 5-Bromoisophthalaldehyde Preparation Products And Raw materials |
|