| Company Name: |
Guangdong Rongyan Chemical Technology Co., Ltd Gold
|
| Tel: |
13196526111 |
| Email: |
505632505@qq.com |
| Products Intro: |
Product Name:Benzaldehyde, 4,4',4'',4'''-(1,6-dihydro-1,3,6,8-pyrenetetrayl)tetrakis-
CAS:2411859-36-2
Purity:98% Package:250mg; 500mg; 1g; 5g; 10g
|
| Company Name: |
Hunan chemfish Scientific co.,ltd
|
| Tel: |
85567275 19313119732 |
| Email: |
sales06@chemfish.com |
| Products Intro: |
Product Name:PYR14
CAS:2411859-36-2
Purity:98% HPLC Package:5KG;1KG
|
| Company Name: |
Zhengzhou anmousse chemical products co. LTD
|
| Tel: |
0371-55289822 18737195735 |
| Email: |
483339295@qq.com |
| Products Intro: |
Product Name:Benzaldehyde, 4,4',4'',4'''-(1,6-dihydro-1,3,6,8-pyrenetetrayl)tetrakis-
CAS:2411859-36-2
Purity:98% Package:5g;10g;25g;50g;100g
|
|
| | Benzaldehyde, 4,4',4'',4'''-(1,6-dihydro-1,3,6,8-pyrenetetrayl)tetrakis- Basic information |
| Product Name: | Benzaldehyde, 4,4',4'',4'''-(1,6-dihydro-1,3,6,8-pyrenetetrayl)tetrakis- | | Synonyms: | Benzaldehyde, 4,4',4'',4'''-(1,6-dihydro-1,3,6,8-pyrenetetrayl)tetrakis-;PYR14;4,4',4'',4'''-(3a1,5-dihydropyrene-1,3,6,8-tetrayl)tetrabenzaldehyde | | CAS: | 2411859-36-2 | | MF: | C44H28O4 | | MW: | 620.69 | | EINECS: | | | Product Categories: | | | Mol File: | 2411859-36-2.mol |  |
| | Benzaldehyde, 4,4',4'',4'''-(1,6-dihydro-1,3,6,8-pyrenetetrayl)tetrakis- Chemical Properties |
| Boiling point | 828.1±65.0 °C(Predicted) | | density | 1.327±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | Appearance | Light yellow to yellow Solid | | InChIKey | LSXIXIMVEICPOH-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(C=C2)C=O)C2C3C4C(=CC=2)C(C2=CC=C(C=C2)C=O)=CC(C2=CC=C(C=C2)C=O)C=4C=CC=3C(C2=CC=C(C=C2)C=O)=C1 |
| | Benzaldehyde, 4,4',4'',4'''-(1,6-dihydro-1,3,6,8-pyrenetetrayl)tetrakis- Usage And Synthesis |
| | Benzaldehyde, 4,4',4'',4'''-(1,6-dihydro-1,3,6,8-pyrenetetrayl)tetrakis- Preparation Products And Raw materials |
|