| Company Name: |
Zhengzhou Acme Chemical Co., Ltd.
|
| Tel: |
0371-037163312495,13303845143 13303845143 |
| Email: |
3001379618@qq.com |
| Products Intro: |
Product Name:Naphthalene, 1-(4'-chloro[1,1'-biphenyl]-4-yl)- CAS:2414502-90-0 Purity:98% Package:5g;25g;100g;500g
|
|
| | Naphthalene, 1-(4'-chloro[1,1'-biphenyl]-4-yl)- Basic information |
| | Naphthalene, 1-(4'-chloro[1,1'-biphenyl]-4-yl)- Chemical Properties |
| Boiling point | 484.9±14.0 °C(Predicted) | | density | 1.183±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C22H15Cl/c23-20-14-12-17(13-15-20)16-8-10-19(11-9-16)22-7-3-5-18-4-1-2-6-21(18)22/h1-15H | | InChIKey | YXZBSNHCAWWCLI-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(C3=CC=C(Cl)C=C3)C=C2)=C2C(C=CC=C2)=CC=C1 |
| | Naphthalene, 1-(4'-chloro[1,1'-biphenyl]-4-yl)- Usage And Synthesis |
| | Naphthalene, 1-(4'-chloro[1,1'-biphenyl]-4-yl)- Preparation Products And Raw materials |
|