|
|
| | 4-Amino-7,8-dichloro-2-methylquinoline Basic information |
| | 4-Amino-7,8-dichloro-2-methylquinoline Chemical Properties |
| Boiling point | 395.1±37.0 °C(Predicted) | | density | 1.426±0.06 g/cm3(Predicted) | | pka | 5.24±0.50(Predicted) | | form | solid | | InChI | 1S/C10H8Cl2N2/c1-5-4-8(13)6-2-3-7(11)9(12)10(6)14-5/h2-4H,1H3,(H2,13,14) | | InChIKey | YOXFYSBUBIJKKS-UHFFFAOYSA-N | | SMILES | Cc1cc(N)c2ccc(Cl)c(Cl)c2n1 |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 4-Amino-7,8-dichloro-2-methylquinoline Usage And Synthesis |
| | 4-Amino-7,8-dichloro-2-methylquinoline Preparation Products And Raw materials |
|