|
|
| | 1,7-Diaza-spiro[4.5]decane-7-carboxylic acid tert-butyl ester Basic information |
| Product Name: | 1,7-Diaza-spiro[4.5]decane-7-carboxylic acid tert-butyl ester | | Synonyms: | 1,7-Diazaspiro[4.5]decane-7-carboxylic acid, 1,1-dimethylethyl ester;1,7-Diaza-spiro[4.5]decan...;1,7-Diazaspiro[4.5]decane-7-carboxylic acid tert-butyl ester - D5999;tert-butyl 1,9-diazaspiro[4.5]decane-9-carboxylate;1,7-diazaspiro[4.5]decylalkane-7-macetic acidtertbutyl ester;tert-butyl 1,7-diazaspiro[4.5]decane-7-carboxylate;1,7-Diaza-spiro[4.5]decane-7-carboxylic acid tert-butyl ester | | CAS: | 939793-21-2 | | MF: | C13H24N2O2 | | MW: | 240.34 | | EINECS: | | | Product Categories: | | | Mol File: | 939793-21-2.mol | ![1,7-Diaza-spiro[4.5]decane-7-carboxylic acid tert-butyl ester Structure](CAS/GIF/939793-21-2.gif) |
| | 1,7-Diaza-spiro[4.5]decane-7-carboxylic acid tert-butyl ester Chemical Properties |
| storage temp. | 2-8°C(protect from light) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C13H24N2O2/c1-12(2,3)17-11(16)15-9-5-7-13(10-15)6-4-8-14-13/h14H,4-10H2,1-3H3 | | InChIKey | PDFULYHFVRJQJO-UHFFFAOYSA-N | | SMILES | N1C2(CCCN(C(OC(C)(C)C)=O)C2)CCC1 |
| | 1,7-Diaza-spiro[4.5]decane-7-carboxylic acid tert-butyl ester Usage And Synthesis |
| Uses | tert-Butyl-1,7-diazaspiro[4.5]decane-7-carboxylate is a useful reagent in preparation of spiro heterocycles as phosphodiesterase inhibitors. | | Pharmaceutical Applications | The major structure of 1,7-DIAZA-SPIRO[4.5]DECANE-7-CARBOXYLIC ACID TERT-BUTYL ESTER, Spiro[4.5]decane, functions as a key intermediate in organic synthesis, particularly for the preparation of pharmaceutical derivatives. For instance, it has been employed in the synthesis of spiro[4.5]decane-based analogues of 1α,25-dihydroxyvitamin D3, which exhibit potential biological activity relevant to therapeutic applications.[1] | | References | [1] Synthesis of Spiro[4.5]decane CF-Ring Analogues of 1α,25-Dihydroxyvitamin D3. Org. Lett. 2006, 8, 19, 4247–4250. DOI:10.1021/ol061575p
|
| | 1,7-Diaza-spiro[4.5]decane-7-carboxylic acid tert-butyl ester Preparation Products And Raw materials |
|