| Company Name: |
Rushpharm Co.,Ltd.
|
| Tel: |
025-66042949 15161141411 |
| Email: |
2244332520@qq.com |
| Products Intro: |
Product Name:1H,3H-Benzo[1,2-c:4,5-c']difuran-1,3,5,7-tetrone, hexahydro-, (3aR,4aR,7aS,8aS)-rel-
CAS:1198787-91-5
Purity:99% HPLC Package:100KG;25KG;10KG;1KG
|
| Company Name: |
Shanghai Yanze Chemical Co., Ltd.
|
| Tel: |
15345144255 19901447308 |
| Email: |
260924549@qq.com |
| Products Intro: |
CAS:1198787-91-5
Purity:99%HPLC Package:100kg;25kg;10kg；5kg；1kg
|
| Company Name: |
Yulin Runtianchang Chemical Co., Ltd
|
| Tel: |
15890160877; 15890142075 |
| Email: |
3555133855@qq.com |
| Products Intro: |
Product Name:(1R,2S,4S,5R)-cyclohexane-1,2,4,5-tetracarboxylic dianhydride
CAS:1198787-91-5
Purity:98%（具体以咨询为准） Package:1g；5g；10g；25g；100g；500g；1kg；25kg；200kg；1T
|
(1R,2S,4S,5R)-cyclohexane-1,2,4,5-tetracarboxylic dianhydride manufacturers
- H"PMDA (ct-PMDA)
-
-
2025-06-05
- CAS:1198787-91-5
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 20MT
|
| | (1R,2S,4S,5R)-cyclohexane-1,2,4,5-tetracarboxylic dianhydride Basic information |
| Product Name: | (1R,2S,4S,5R)-cyclohexane-1,2,4,5-tetracarboxylic dianhydride | | Synonyms: | 1H,3H-Benzo[1,2-c:4,5-c']difuran-1,3,5,7-tetrone, hexahydro-, (3aR,4aR,7aS,8aS)-rel-;H"PMDA (ct-PMDA);(1R,2S,4S,5R)-cyclohexane-1,2,4,5-tetracarboxylic dianhydride | | CAS: | 1198787-91-5 | | MF: | C10H8O6 | | MW: | 224.17 | | EINECS: | | | Product Categories: | | | Mol File: | 1198787-91-5.mol |  |
| | (1R,2S,4S,5R)-cyclohexane-1,2,4,5-tetracarboxylic dianhydride Chemical Properties |
| Melting point | 273 °C(Solvent: Acetic anhydride) | | Boiling point | 517.5±50.0 °C(Predicted) | | density | 1.567±0.06 g/cm3(Predicted) | | InChI | InChI=1/C10H8O6/c11-7-3-1-4-6(10(14)16-8(4)12)2-5(3)9(13)15-7/h3-6H,1-2H2/t3-,4-,5+,6+ | | InChIKey | LJMPOXUWPWEILS-RJYLNQFNNA-N | | SMILES | O1C(=O)[C@]2([H])C[C@]3([H])[C@]([H])(C[C@]2([H])C1=O)C(=O)OC3=O |&1:3,6,8,11,r| |
| | (1R,2S,4S,5R)-cyclohexane-1,2,4,5-tetracarboxylic dianhydride Usage And Synthesis |
| Chemical Properties | White crystal powder. | | Uses | (1R,2S,4S,5R)-cyclohexane-1,2,4,5-tetracarboxylic dianhydride is an organic synthesis intermediate, which can be used as curing agent and electrical filler. |
| | (1R,2S,4S,5R)-cyclohexane-1,2,4,5-tetracarboxylic dianhydride Preparation Products And Raw materials |
|