|
|
| | {4-[3-(Dimethylamino)propoxy]phenyl}methanol Basic information |
| Product Name: | {4-[3-(Dimethylamino)propoxy]phenyl}methanol | | Synonyms: | {4-[3-(Dimethylamino)propoxy]phenyl}methanol;4-[3-(Dimethylamino)propoxy]benzyl alcohol;4-[3-(Dimethylamino)propoxy]benzyl alcohol 97%;{4-[3-(Dimethylamino)propoxy]phenyl}methanol, N,N-Dimethyl-3-[4-(hydroxymethyl)phenoxy]propylamine;(4-(3-(Dimethylamino);Benzenemethanol,4-[3-(dimethylamino)propoxy]- | | CAS: | 426831-08-5 | | MF: | C12H19NO2 | | MW: | 209.28 | | EINECS: | | | Product Categories: | | | Mol File: | 426831-08-5.mol | ![{4-[3-(Dimethylamino)propoxy]phenyl}methanol Structure](CAS/GIF/426831-08-5.gif) |
| | {4-[3-(Dimethylamino)propoxy]phenyl}methanol Chemical Properties |
| Boiling point | 336.9±27.0 °C(Predicted) | | density | 1.043±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 14.52±0.10(Predicted) | | InChI | InChI=1S/C12H19NO2/c1-13(2)8-3-9-15-12-6-4-11(10-14)5-7-12/h4-7,14H,3,8-10H2,1-2H3 | | InChIKey | ZLCIFBOMXUAJPZ-UHFFFAOYSA-N | | SMILES | C1(CO)=CC=C(OCCCN(C)C)C=C1 | | CAS DataBase Reference | 426831-08-5 |
| Hazard Codes | C | | Hazard Note | Corrosive | | HS Code | 2922500090 |
| | {4-[3-(Dimethylamino)propoxy]phenyl}methanol Usage And Synthesis |
| | {4-[3-(Dimethylamino)propoxy]phenyl}methanol Preparation Products And Raw materials |
|