|
|
| | 2,6-dibromo-3-methyl-4-nitroanisole Basic information | | Uses |
| Product Name: | 2,6-dibromo-3-methyl-4-nitroanisole | | Synonyms: | 2,6-dibromo-3-methyl-4-nitroanisole;Benzene, 1,3-dibromo-2-methoxy-4-methyl-5-nitro-;2,4-Dibromo-3-methoxy-6-nitrotoluene;1,3-Dibromo-2-methoxy-4-methyl-5-nitrobenzene;RBAJFFLBHVZCDY-UHFFFAOYSA-N | | CAS: | 62265-99-0 | | MF: | C8H7Br2NO3 | | MW: | 324.95 | | EINECS: | 263-479-7 | | Product Categories: | Organics | | Mol File: | 62265-99-0.mol |  |
| | 2,6-dibromo-3-methyl-4-nitroanisole Chemical Properties |
| Boiling point | 354.5±37.0 °C(Predicted) | | density | 1.868±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C8H7Br2NO3/c1-4-6(11(12)13)3-5(9)8(14-2)7(4)10/h3H,1-2H3 | | InChIKey | RBAJFFLBHVZCDY-UHFFFAOYSA-N | | SMILES | C1(Br)=CC([N+]([O-])=O)=C(C)C(Br)=C1OC | | EPA Substance Registry System | 2,6-Dibromo-3-methyl-4-nitroanisole (62265-99-0) |
| | 2,6-dibromo-3-methyl-4-nitroanisole Usage And Synthesis |
| Uses | 2,6-Dibromo-3-methyl-4-nitrobenzene is mainly used in laboratory organic synthesis and in chemical and pharmaceutical research and development. |
| | 2,6-dibromo-3-methyl-4-nitroanisole Preparation Products And Raw materials |
|