|
|
| | 3-Methyl-4-nitroanisole Basic information |
| | 3-Methyl-4-nitroanisole Chemical Properties |
| Melting point | 48-50 °C (lit.) | | Boiling point | 135 °C / 0.5mmHg | | density | 1.2917 (rough estimate) | | refractive index | 1.5570 (estimate) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | Light yellow to Brown | | BRN | 2328600 | | InChI | 1S/C8H9NO3/c1-6-5-7(12-2)3-4-8(6)9(10)11/h3-5H,1-2H3 | | InChIKey | RTZOGYCMIMOVHU-UHFFFAOYSA-N | | SMILES | COc1ccc(c(C)c1)[N+]([O-])=O | | CAS DataBase Reference | 5367-32-8(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 4-methoxy-2-methyl-1-nitro-(5367-32-8) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29093090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Methyl-4-nitroanisole Usage And Synthesis |
| Chemical Properties | yellow to brown powder | | Uses | 3-Methyl-4-nitroanisole was used in the preparation of enamine. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 45, p. 522, 1980 DOI: 10.1021/jo01291a031 |
| | 3-Methyl-4-nitroanisole Preparation Products And Raw materials |
|