| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | thiodiethane-1,2-diyl bis(3-aminobut-2-enoate) Basic information |
| Product Name: | thiodiethane-1,2-diyl bis(3-aminobut-2-enoate) | | Synonyms: | 3-Thia-1,5-pentanediolbis(3-amino-crotonate);2,2'-Thiodiethyl bis(β-aminocrotonate);Bis(3-aminocrotonic acid)thiobis(2,1-ethanediyl) ester;Bis[(Z)-3-amino-2-butenoic acid]thiobis(2,1-ethanediyl) ester;Thiodiethylene glycol bis(3-aminocrotonate);thiodiethane-1,2-diyl bis(3-aminobut-2-enoate);2-Butenoic acid, 3-amino-, thiodi-2,1-ethanediyl ester;BETA-AMINO-CROTONATEOFTHIODIETHYLENEGLYCOL | | CAS: | 13560-49-1 | | MF: | C12H20N2O4S | | MW: | 288.36 | | EINECS: | 236-946-8 | | Product Categories: | | | Mol File: | 13560-49-1.mol |  |
| | thiodiethane-1,2-diyl bis(3-aminobut-2-enoate) Chemical Properties |
| Melting point | 89-92℃ | | Boiling point | 479℃ | | density | 1.192 | | Fp | 243℃ | | pka | 5.55±0.70(Predicted) | | form | lumps | | InChI | 1S/C12H20N2O4S/c1-9(13)7-11(15)17-3-5-19-6-4-18-12(16)8-10(2)14/h7-8H,3-6,13-14H2,1-2H3/b9-7-,10-8- | | InChIKey | GZVBGWRBVGVPLI-XOHWUJONSA-N | | SMILES | C\C(N)=C\C(=O)OCCSCCOC(=O)\C=C(\C)N | | EPA Substance Registry System | 2-Butenoic acid, 3-amino-, 1,1'-(thiodi-2,1-ethanediyl) ester (13560-49-1) |
| WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 13 - Non Combustible Solids | | Toxicity | rat,LD50,oral,> 7gm/kg (7000mg/kg),Food and Cosmetics Toxicology. Vol. 7, Pg. 473, 1969. |
| | thiodiethane-1,2-diyl bis(3-aminobut-2-enoate) Usage And Synthesis |
| Chemical Properties | Yellowish powder | | Uses | thiodiethane-1,2-diyl bis(3-aminobut-2-enoate)(TGAC) is used as stabilizer for PVC against light and heat. |
| | thiodiethane-1,2-diyl bis(3-aminobut-2-enoate) Preparation Products And Raw materials |
|