|
|
| | 4,4'-dimethoxytrityl alcohol Basic information |
| Product Name: | 4,4'-dimethoxytrityl alcohol | | Synonyms: | 4,4'-dimethoxytrityl alcohol;4-Methoxy-α-(4-methoxyphenyl)-α-phenylbenzenemethanol;Bis(4-methoxyphenyl)phenylmethanol;Phenylbis(4-methoxyphenyl)methanol;α,α-Bis(4-methoxyphenyl)benzenemethanol;4-Methoxy-α-(4-methoxyphenyl)-α-phenylbenzenemethano;Benzenemethanol, 4-methoxy-α-(4-methoxyphenyl)-α-phenyl-;p,p'-Dimethoxytriphenylcarbinol | | CAS: | 40615-35-8 | | MF: | C21H20O3 | | MW: | 320.38 | | EINECS: | 255-001-0 | | Product Categories: | | | Mol File: | 40615-35-8.mol |  |
| | 4,4'-dimethoxytrityl alcohol Chemical Properties |
| Melting point | 75-76 °C | | Boiling point | 488.0±45.0 °C(Predicted) | | density | 1.151±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 12.87±0.29(Predicted) | | color | Colourless Sticky Oil | | InChI | InChI=1S/C21H20O3/c1-23-19-12-8-17(9-13-19)21(22,16-6-4-3-5-7-16)18-10-14-20(24-2)15-11-18/h3-15,22H,1-2H3 | | InChIKey | XESTYUYENKNHHR-UHFFFAOYSA-N | | SMILES | C(O)(C1=CC=CC=C1)(C1=CC=C(OC)C=C1)C1=CC=C(OC)C=C1 |
| | 4,4'-dimethoxytrityl alcohol Usage And Synthesis |
| Uses | p,p''-Dimethoxytriphenylcarbinol, can be used in Amberlyst-15 catalyzed regioselective tritylation of sugar-based diols. |
| | 4,4'-dimethoxytrityl alcohol Preparation Products And Raw materials |
|