| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Pentamethoxy red manufacturers
- PENTAMETHOXY RED
-
-
2026-09-01
- CAS:1755-51-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20tons
- PENTAMETHOXY RED
-
-
2026-06-30
- CAS:1755-51-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kg
|
| | Pentamethoxy red Basic information |
| Product Name: | Pentamethoxy red | | Synonyms: | Pentamethoxylred;BIS(2,4-DIMETHOXYPHENYL)(2-METHOXYPHENYL)METHANOL;2,2',2'',4,4'-PENTAMETHOXYTRIPHENYLMETHANOL;2,2',2'',4,4'-pentamethoxytrityl alcohol;2,2',2",4,4'-Pentamethoxytriphenylcarbinol;Benzenemethanol, .alpha.-(2,4-dimethoxyphenyl)-2,4-dimethoxy-.alpha.-(2-methoxyphenyl)-;α-(2,4-Dimethoxyphenyl)-2,4-dimethoxy-α-(2-methoxyphenyl)benzenemethanol;2,2',2 | | CAS: | 1755-51-7 | | MF: | C24H26O6 | | MW: | 410.46 | | EINECS: | 217-146-8 | | Product Categories: | Analytical Chemistry;Indicator (pH);pH Indicators;Triphenylmethane | | Mol File: | 1755-51-7.mol |  |
| | Pentamethoxy red Chemical Properties |
| Melting point | 146°C | | solubility | Solubility Insoluble in water; soluble in ethanol | | form | crystals | | pka | 1.86(at 25℃) | | color | White | | PH Range | Reddish-violet (1.2) to colorless (3.2) | | Major Application | Image producing materials, recording materials, resist composition, copier materials, inks, cleaners, cosmetics, dental adhesives | | InChI | InChI=1S/C24H26O6/c1-26-16-10-12-19(22(14-16)29-4)24(25,18-8-6-7-9-21(18)28-3)20-13-11-17(27-2)15-23(20)30-5/h6-15,25H,1-5H3 | | InChIKey | GEPSNGQKRLULHW-UHFFFAOYSA-N | | SMILES | C(O)(C1C=CC=CC=1OC)(C1=CC=C(OC)C=C1OC)C1=CC=C(OC)C=C1OC |
| | Pentamethoxy red Usage And Synthesis |
| Uses | Pentamethoxy red is a kind of biochemical reagent. | | References | [1] Bergmeyer, et al. "Biochemical reagents." Methods of Enzymatic Analysis. Academic Press, 1965. 967-1037. |
| | Pentamethoxy red Preparation Products And Raw materials |
|