|
|
| | chlorphentermine hydrochloride Basic information |
| Product Name: | chlorphentermine hydrochloride | | Synonyms: | chlorphentermine hydrochloride;Benzeneethanamine, 4-chloro-.alpha.,.alpha.-dimethyl-, hydrochloride;1-(4-chlorophenyl)-2-methyl-propan-2-amine hydrochloride;1-(4-chlorophenyl)-2-methylpropan-2-amine hydrochloride;(4-Chlorophenyl)-2-Methylpropan-2-aMine Hydrochloride;4-Chloro-α,α-diMethyl-1-benzeneethanaMine Hydrochloride;4-Chloro-α,α-diMethylphenethylaMine Hydrochloride;p-Chloro-α,α-diMethylphenethylaMine Hydrochloride | | CAS: | 151-06-4 | | MF: | C10H14ClN.ClH | | MW: | 0 | | EINECS: | 2057829 | | Product Categories: | Amines;Aromatics;Intermediates & Fine Chemicals;Neurochemicals;Pharmaceuticals | | Mol File: | 151-06-4.mol |  |
| | chlorphentermine hydrochloride Chemical Properties |
| Melting point | 234℃ | | solubility | H2O: 2 mg/mL, clear | | form | Solid | | color | white to beige | | SMILES | NC(C)(C)CC1=CC=C(C=C1)Cl.Cl |
| Toxicity | LD50 in mice (mg/kg): 270 orally; 267 s.c. (Ciborska) |
| | chlorphentermine hydrochloride Usage And Synthesis |
| Uses | chlorphentermine hydrochloride is an anorectic agent. Chlorphentermine is the 4-chloro derivative of the better known appetite suppressant Phentermine (P318830). chlorphentermine hydrochloride is structurally related to amphetamine but is a relatively weak stimulant with little abuse potential. | | Brand name | Pre-Sate (Parke-Davis). | | Safety Profile | Poison by ingestion,subcutaneous, intraperitoneal, and intravenous routes.Experimental reproductive effects. When heated todecomposition it emits very toxic fumes of HCl and NOx.An anorexic agent. |
| | chlorphentermine hydrochloride Preparation Products And Raw materials |
|