dioctyl terephthalate manufacturers
- dioctyl terephthalate
-
- $1.00
-
2026-08-07
- CAS:4654-26-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100000KG
- dioctyl terephthalate
-
- $1.00
-
2020-01-15
- CAS:4654-26-6
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1kg ,5kg, 50kg
|
| | dioctyl terephthalate Basic information |
| Product Name: | dioctyl terephthalate | | Synonyms: | DI-N-OCTYLTEREPHTHALATE;Terephthalic acid dioctyl ester;1,4-Benzenedicarboxylic acid, dioctyl ester;1,4-Benzenedicarboxylic acid, 1,4-dioctyl ester | | CAS: | 4654-26-6 | | MF: | C24H38O4 | | MW: | 390.56 | | EINECS: | 225-091-6 | | Product Categories: | | | Mol File: | 4654-26-6.mol |  |
| | dioctyl terephthalate Chemical Properties |
| Melting point | 41-42 °C | | Boiling point | 435.74°C (rough estimate) | | density | 1.0101 (rough estimate) | | refractive index | 1.4460 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | InChI | InChI=1S/C24H38O4/c1-3-5-7-9-11-13-19-27-23(25)21-15-17-22(18-16-21)24(26)28-20-14-12-10-8-6-4-2/h15-18H,3-14,19-20H2,1-2H3 | | InChIKey | OEIWPNWSDYFMIL-UHFFFAOYSA-N | | SMILES | C1(C(OCCCCCCCC)=O)=CC=C(C(OCCCCCCCC)=O)C=C1 | | EPA Substance Registry System | Dioctyl terephthalate (4654-26-6) |
| | dioctyl terephthalate Usage And Synthesis |
| Uses | Dioctyl terephthalate has a low melting point and good heat resistance, cold resistance and low volatility. It is particularly suitable for processing PVC plastics, giving the products excellent electrical insulation properties, durability, soap water resistance and low temperature flexibility. |
| | dioctyl terephthalate Preparation Products And Raw materials |
|