dibutyl terephthalate manufacturers
|
| | dibutyl terephthalate Basic information |
| Product Name: | dibutyl terephthalate | | Synonyms: | dibutyl benzene-1,4-dicarboxylate;NSC 6349;1,4-Benzenedicarboxylic acid 1,4-dibutyl ester;DI-N-BUTYLTEREPHTHALATE;1,4-Benzenedicarboxylic acid dibutyl ester;Terephthalic acid dibutyl ester;benzene-1,4-dicarboxylic acid dibutyl ester;dibutyl terephthalate | | CAS: | 1962-75-0 | | MF: | C16H22O4 | | MW: | 278.34 | | EINECS: | 217-803-9 | | Product Categories: | | | Mol File: | 1962-75-0.mol |  |
| | dibutyl terephthalate Chemical Properties |
| Melting point | 16℃ | | Boiling point | 381.16°C (rough estimate) | | density | 1.053 | | refractive index | 1.463 (45 ºC) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Water Solubility | 5μg/L at 25℃ | | InChI | InChI=1S/C16H22O4/c1-3-5-11-19-15(17)13-7-9-14(10-8-13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3 | | InChIKey | LQLQDKBJAIILIQ-UHFFFAOYSA-N | | SMILES | C1(C(OCCCC)=O)=CC=C(C(OCCCC)=O)C=C1 | | EPA Substance Registry System | Dibutyl terephthalate (1962-75-0) |
| | dibutyl terephthalate Usage And Synthesis |
| Definition | ChEBI: Dibutyl terephthalate is a phthalate ester. |
| | dibutyl terephthalate Preparation Products And Raw materials |
|