pentadecan-8-ol manufacturers
- 8-Pentadecanol
-
- $2.20
-
2026-08-25
- CAS:1653-35-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 50kg
|
| | pentadecan-8-ol Basic information |
| | pentadecan-8-ol Chemical Properties |
| Melting point | 53.5-54.3 °C(Solv: ethyl acetate (141-78-6)) | | Boiling point | 300.24°C (estimate) | | density | 0.8221 (estimate) | | refractive index | 1.4249 (estimate) | | storage temp. | Store at room temperature | | pka | 15.36±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C15H32O/c1-3-5-7-9-11-13-15(16)14-12-10-8-6-4-2/h15-16H,3-14H2,1-2H3 | | InChIKey | AXCJQGZCVXCVAG-UHFFFAOYSA-N | | SMILES | CCCCCCCC(O)CCCCCCC |
| | pentadecan-8-ol Usage And Synthesis |
| | pentadecan-8-ol Preparation Products And Raw materials |
|