| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | N-cyclohexyl-N-methyl-o-nitrobenzylamine Basic information |
| Product Name: | N-cyclohexyl-N-methyl-o-nitrobenzylamine | | Synonyms: | N-(2-Nitrobenzyl)-N-methylcyclohexanamine;N-cyclohexyl-N-methyl-o-nitrobenzylamine;N-Cyclohexyl-N-methyl-2-nitrobenzenemethanamine;Einecs 279-522-8;Bromhexine Impurity (N-(2-Nitrobenzyl)-N-cyclohexyl-N-methylamine);N-Cyclohexyl-N-methyl-2-nitrobenzylamine;N-methyl-N-[(2-nitrophenyl)methyl]cyclohexanamine;N-(2-Nitrobenzyl)-N-cyclohexyl-N-me | | CAS: | 80638-08-0 | | MF: | C14H20N2O2 | | MW: | 248.32 | | EINECS: | 279-522-8 | | Product Categories: | | | Mol File: | 80638-08-0.mol |  |
| | N-cyclohexyl-N-methyl-o-nitrobenzylamine Chemical Properties |
| Boiling point | 116-119 °C(Press: 0.06 Torr) | | density | 1.12±0.1 g/cm3(Predicted) | | pka | 8.27±0.20(Predicted) | | InChI | InChI=1S/C14H20N2O2/c1-15(13-8-3-2-4-9-13)11-12-7-5-6-10-14(12)16(17)18/h5-7,10,13H,2-4,8-9,11H2,1H3 | | InChIKey | GDRZPWMSPDDHEA-UHFFFAOYSA-N | | SMILES | C1(CN(C2CCCCC2)C)=CC=CC=C1[N+]([O-])=O |
| | N-cyclohexyl-N-methyl-o-nitrobenzylamine Usage And Synthesis |
| Uses | N-Cyclohexyl-N-methyl-2-nitrobenzenemethanamine is an intermediate in the preparation of bromohexine tablets which is a mucolytic drug used in the treatment of respiratory disorders with excessive mucus. |
| | N-cyclohexyl-N-methyl-o-nitrobenzylamine Preparation Products And Raw materials |
|