propyl benzenesulphonate manufacturers
|
| | propyl benzenesulphonate Basic information |
| | propyl benzenesulphonate Chemical Properties |
| Boiling point | 307.98°C (rough estimate) | | density | 1.1804 | | refractive index | 1.5035 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Oil | | color | Colourless | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C9H12O3S/c1-2-8-12-13(10,11)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 | | InChIKey | OCNPXKLQSGAGKT-UHFFFAOYSA-N | | SMILES | C1(S(OCCC)(=O)=O)=CC=CC=C1 | | EPA Substance Registry System | Benzenesulfonic acid, propyl ester (80-42-2) |
| | propyl benzenesulphonate Usage And Synthesis |
| Uses | Butyl Benzenesulfonate is an aryl-sulfonate genotoxic impurity found in trace levels in drug substances. |
| | propyl benzenesulphonate Preparation Products And Raw materials |
|