|
|
| | 3,3'-dithiobis(propionohydrazide) Basic information |
| Product Name: | 3,3'-dithiobis(propionohydrazide) | | Synonyms: | 3,3'-dithiobis(propionohydrazide);4,5-dithia-octanedioic acid dihydrazide;3,3'-Dithiobis(propanoic dihydrazide);3-[(3-hydrazinyl-3-oxopropyl)disulfanyl]propanehydrazide;Propanoic acid, 3,3'-dithiobis-, 1,1'-dihydrazide;3,3'-Disulfanediyldipropanohydrazide;3,3'-Disulfanediyldi(propanehydrazide) | | CAS: | 50906-77-9 | | MF: | C6H14N4O2S2 | | MW: | 238.33 | | EINECS: | 256-838-4 | | Product Categories: | | | Mol File: | 50906-77-9.mol |  |
| | 3,3'-dithiobis(propionohydrazide) Chemical Properties |
| Melting point | 128 °C(Solv: ethanol (64-17-5)) | | Boiling point | 581.4±35.0 °C(Predicted) | | density | 1.363±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly, Heated) | | form | Solid | | pka | 12.55±0.35(Predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C6H14N4O2S2/c7-9-5(11)1-3-13-14-4-2-6(12)10-8/h1-4,7-8H2,(H,9,11)(H,10,12) | | InChIKey | GYQOUZKNOIHPOP-UHFFFAOYSA-N | | SMILES | S(CCC(NN)=O)SCCC(NN)=O |
| | 3,3'-dithiobis(propionohydrazide) Usage And Synthesis |
| | 3,3'-dithiobis(propionohydrazide) Preparation Products And Raw materials |
|