|
|
| Product Name: | Malonic dihydrazide | | Synonyms: | MALONIC DIHYDRAZIDE;MALONOHYDRAZIDE;MALONYL DIHYDRAZIDE;AKOS BBS-00001036;Malonhydrazide;Malonic acid hydrazide;malonicacidhydrazide;Malonodihydrazide | | CAS: | 3815-86-9 | | MF: | C3H8N4O2 | | MW: | 132.12 | | EINECS: | 670-404-5 | | Product Categories: | raw materials | | Mol File: | 3815-86-9.mol |  |
| | Malonic dihydrazide Chemical Properties |
| Melting point | 152-154°C | | Boiling point | 554.0±33.0 °C(Predicted) | | density | 1.358±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 11.88±0.35(Predicted) | | form | powder to crystal | | color | White to Almost white | | BRN | 1072337 | | InChI | InChI=1S/C3H8N4O2/c4-6-2(8)1-3(9)7-5/h1,4-5H2,(H,6,8)(H,7,9) | | InChIKey | PSIKPHJLTVSQFO-UHFFFAOYSA-N | | SMILES | C(C(=O)NN)C(=O)NN | | CAS DataBase Reference | 3815-86-9(CAS DataBase Reference) | | NIST Chemistry Reference | Propanedioyl dihydrazide(3815-86-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RTECS | OO8000000 | | HS Code | 2928.00.5000 | | HazardClass | IRRITANT |
| Provider | Language |
|
ALFA
| English |
| | Malonic dihydrazide Usage And Synthesis |
| Application | Malonyl hydrazide is an acyl hydrazide derivative, mainly used in the fields of fluorescence chemistry and materials chemistry. | | Chemical Properties | Malonic acid hydrazide behaves as a white crystalline powder at room temperature and pressure, and the hydrazide group can be formed into a stable hydrazone bond by reacting with aldehydes or ketones. |
| | Malonic dihydrazide Preparation Products And Raw materials |
|