|
|
| | Methyl 3-methyl-2-benzofurancarboxylate Basic information |
| Product Name: | Methyl 3-methyl-2-benzofurancarboxylate | | Synonyms: | methyl 3-methyl-2-benzofurancarboxylate;3-Methylbenzofuran-2-carboxylic acid methyl ester;methyl 3-methyl-1-benzofuran-2-carboxylate;3-methyl-1-isobenzofurancarboxylic acid methyl ester;2-Benzofurancarboxylic acid, 3-methyl-, methyl ester;methyl 3-methylbenzofuran-2-carboxylate | | CAS: | 2076-36-0 | | MF: | C11H10O3 | | MW: | 190.2 | | EINECS: | 218-198-4 | | Product Categories: | | | Mol File: | 2076-36-0.mol |  |
| | Methyl 3-methyl-2-benzofurancarboxylate Chemical Properties |
| Melting point | 69-70 °C | | Boiling point | 130-135 °C(Press: 1 Torr) | | density | 1.184±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H10O3/c1-7-8-5-3-4-6-9(8)14-10(7)11(12)13-2/h3-6H,1-2H3 | | InChIKey | HVUOTQOUAMXGLR-UHFFFAOYSA-N | | SMILES | O1C2=CC=CC=C2C(C)=C1C(OC)=O |
| | Methyl 3-methyl-2-benzofurancarboxylate Usage And Synthesis |
| Uses | 3-Methylbenzofuran-2-carboxylic Acid Methyl Ester acts as a reagent in the synthesis and SAR of highly selective MMP-13 Inhibitors, preparation of saframycin analogs for the treatment of cancer. |
| | Methyl 3-methyl-2-benzofurancarboxylate Preparation Products And Raw materials |
|